casticin

{{Chembox

| ImageFile = Casticin.svg

| ImageSize = 250px

| ImageAlt =

| IUPACName = 3′,5-Dihydroxy-3,4′,6,7-tetramethoxyflavone

| SystematicName = 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,6,7-trimethoxy-4H-1-benzopyran-4-one

| OtherNames = Vitexicarpin

|Section1={{Chembox Identifiers

| CASNo = 479-91-4

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 753GT729OU

| PubChem = 5315263

| ChEBI = 69355

| ChemSpiderID = 4474632

| ChEMBL = 452767

| InChI = 1/C19H18O8/c1-23-11-6-5-9(7-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3

| InChIKey = PJQLSMYMOKWUJG-UHFFFAOYAH

| StdInChI = 1S/C19H18O8/c1-23-11-6-5-9(7-10(11)20)17-19(26-4)16(22)14-12(27-17)8-13(24-2)18(25-3)15(14)21/h5-8,20-21H,1-4H3

| StdInChIKey = PJQLSMYMOKWUJG-UHFFFAOYSA-N

| SMILES = COC1=C(C=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)OC)O}}

|Section2={{Chembox Properties

| Formula = C₁₉H₁₈O₈

| MolarMass = 374.34 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Casticin is a methoxylated flavonol, meaning the core flavonoid structure has methyl groups attached. Found in Artemisia annua, the flavonoid has been shown to enhance the antimalarial activity of artemisinin though casticin itself has no direct antimalarial effects.{{cite journal| author1 = Elford BC| author2 = Roberts MF| author3 = Phillipson JD | author4 = Wilson RJ| date = 1987| title = Potentiation of the antimalarial activity of qinghaosu by methoxylated flavones| journal = Trans R Soc Trop Med Hyg| volume = 81| issue = 3| pages = 434–436| pmid =3318019| doi=10.1016/0035-9203(87)90161-1}}{{cite journal| author1 = Liu KC| author2 = Yang SL | author3 = Roberts MF | author4 = Elford BC | author5 = Phillipson JD |date = 1992| title = Antimalarial activity of Artemisia annua flavonoids from whole plants and cell cultures | journal = Plant Cell Rep | volume = 11| issue = 12| pages =537–640| pmid = 24213368 | doi=10.1007/bf00236389| s2cid = 9405266 }} It has been shown to have anti-mitotic activity. It is also found in Vitex agnus-castus.{{cite journal | last1 = Hoberg | first1 = Eva | last2 = Meier | first2 = Beat | last3 = Sticher | first3 = Otto | year = 2000 | title = An analytical high performance liquid chromatographic method for the determination of agnuside and p-hydroxybenzoic acid contents in Agni-casti fructus | journal = Phytochemical Analysis | volume = 11 | issue = 5| pages = 327–329 | doi = 10.1002/1099-1565(200009/10)11:5<327::AID-PCA523>3.0.CO;2-0 }}