casuarictin

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 404125723

| Name = Casuarictin

| ImageFile = Casuarictin.svg

| ImageSize =

| ImageName = Chemical structure of casuarictin

| SystematicName = (10aR,11S,12aR,25aR,25bS)-2,3,4,5,6,7,17,18,19,20,21,22-Dodecahydroxy-9,15,24,27-tetraoxo-9,10a,11,12a,13,15,24,25a,25b,27-decahydrodibenzo[g,i]dibenzo[6′,7′:8′,9′][1,4]dioxecino[2′,3′:4,5]pyrano[3,2-b][1,5]dioxacycloundecin-11-yl 3,4,5-trihydroxybenzoate

| OtherNames = Sanguiin H 11
Sanguiin H-11
1(β)-O-Galloylpedunculagin

|Section1={{Chembox Identifiers

| CASNo = 79786-00-8

| CASNo_Ref = {{cascite|correct|??}}

| CASNo2_Ref = {{cascite|changed|??}}

| CASNo2 = 96292-46-5

| PubChem = 73644

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1076705

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 66302

| SMILES = c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@H]3[C@H]([C@H]4[C@H](O2)COC(=O)c5cc(c(c(c5-c6c(cc(c(c6O)O)O)C(=O)O4)O)O)O)OC(=O)c7cc(c(c(c7-c8c(cc(c(c8O)O)O)C(=O)O3)O)O)O

| InChI = 1/C41H28O26/c42-13-1-8(2-14(43)24(13)48)36(57)67-41-35-34(65-39(60)11-5-17(46)27(51)31(55)22(11)23-12(40(61)66-35)6-18(47)28(52)32(23)56)33-19(63-41)7-62-37(58)9-3-15(44)25(49)29(53)20(9)21-10(38(59)64-33)4-16(45)26(50)30(21)54/h1-6,19,33-35,41-56H,7H2/t19-,33-,34+,35-,41+/m1/s1

| InChIKey = SWRFKGRMQVLMKA-JIZJWZDPBX

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C41H28O26/c42-13-1-8(2-14(43)24(13)48)36(57)67-41-35-34(65-39(60)11-5-17(46)27(51)31(55)22(11)23-12(40(61)66-35)6-18(47)28(52)32(23)56)33-19(63-41)7-62-37(58)9-3-15(44)25(49)29(53)20(9)21-10(38(59)64-33)4-16(45)26(50)30(21)54/h1-6,19,33-35,41-56H,7H2/t19-,33-,34+,35-,41+/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = SWRFKGRMQVLMKA-JIZJWZDPSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| Formula = C₄₁H₂₈O₂₆

| MolarMass = 936.64 g/mol

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

}}

Casuarictin is an ellagitannin, a type of hydrolysable tannin. It can be found in Casuarina and Stachyurus species.Tannins of Casuarina and Stachyurus species. I: Structures of pendunculagin, casuarictin, strictinin, casuarinin, casuariin, and stachyurin. Okuda T., Yoshida T., Ashida M. and Yazaki K., Journal of the Chemical Society, 1983, number 8, pages 1765-1772, {{INIST|9467908}}

It is formed from two hexahydroxydiphenic acid units and one gallic acid unit linked to a glucose molecule.

The molecule is formed from tellimagrandin II, itself formed from pentagalloyl glucose via oxidation. Casuarictin is transformed into pedunculagin via loss of a gallate group, and further into castalagin via glucose pyranose ring opening.