cefazedone

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443771825

| IUPAC_name = (6R,7R)-7-{[2-(3,5-dichloro-4-oxopyridin-1-yl)
acetyl]amino}-3-[(5-methyl-1,3,4-thiadiazol-2-yl)
sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]
oct-2-ene-2-carboxylic acid

| image = cefazedone.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 56187-47-4

| ATC_prefix = J01

| ATC_suffix = DB06

| PubChem = 71736

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEBI = 131731

| ChEMBL = 2107636

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64780

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7Y86X0D799

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07237

| C=18 | H=15 | Cl=2 | N=5 | O=5 | S=3

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)CN/3/C=C(/Cl)C(=O)C(\Cl)=C\3)CSc4nnc(s4)C)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C18H15Cl2N5O5S3/c1-7-22-23-18(33-7)32-6-8-5-31-16-12(15(28)25(16)13(8)17(29)30)21-11(26)4-24-2-9(19)14(27)10(20)3-24/h2-3,12,16H,4-6H2,1H3,(H,21,26)(H,29,30)/t12-,16-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = VTLCNEGVSVJLDN-MLGOLLRUSA-N

}}

Cefazedone is a cephalosporin antibiotic.{{cite journal | vauthors = Wahlig H, Dingeldein E, Mitsuhashi S, Kawabe H | title = Cefazedone: microbiological evaluation in comparison with cephalothin and cefazolin | journal = Arzneimittel-Forschung | volume = 29 | issue = 2a | pages = 369–78 | date = 1979 | pmid = 582712 | doi = | url = }}