ceforanide

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 460023791

| IUPAC_name = (6R,7R)-7-{[2-[2-(aminomethyl)phenyl]acetyl]amino}-3-
{[1-(carboxymethyl)tetrazol-5-yl]sulfanylmethyl}-8-oxo-
5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Ceforanide.svg

| tradename =

| Drugs.com = {{drugs.com|international|ceforanide}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Intramuscular

| bioavailability =

| protein_bound = 80.6%

| metabolism = Nil

| elimination_half-life = 2.6 to 2.98 hours

| excretion = Renal

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 60925-61-3

| ATC_prefix = J01

| ATC_suffix = DC11

| ATC_supplemental =

| PubChem = 43507

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00923

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 39656

| NIAID_ChemDB = 007642

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 8M1YF8951V

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00259

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 3495

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201046

| C=20 | H=21 | N=7 | O=6 | S=2

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)Cc3ccccc3CN)CSc4nnnn4CC(=O)O)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C20H21N7O6S2/c21-6-11-4-2-1-3-10(11)5-13(28)22-15-17(31)27-16(19(32)33)12(8-34-18(15)27)9-35-20-23-24-25-26(20)7-14(29)30/h1-4,15,18H,5-9,21H2,(H,22,28)(H,29,30)(H,32,33)/t15-,18-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = SLAYUXIURFNXPG-CRAIPNDOSA-N

}}

Ceforanide is a second-generation cephalosporin antibiotic.{{cite journal | vauthors = Crowle A, Sbarbaro J, May M | title = Effects of isoniazid and of ceforanide against virulent tubercle bacilli in cultured human macrophages. | journal = Tubercle | volume = 69 | issue = 1 | pages = 15–25 | year = 1988 | pmid = 3140456 | doi = 10.1016/0041-3879(88)90036-0}}{{cite journal | vauthors = Campoli-Richards D, Lackner T, Monk J | title = Ceforanide. A review of its antibacterial activity, pharmacokinetic properties and clinical efficacy. | journal = Drugs | volume = 34 | issue = 4 | pages = 411–37 | year = 1987 | pmid = 3315624 | doi=10.2165/00003495-198734040-00001| s2cid = 242440792 }}{{cite journal | vauthors = Cone L, Barton S, Woodard D | title = Treatment of scleroma with ceforanide. | journal = Arch Otolaryngol Head Neck Surg | volume = 113 | issue = 4 | pages = 374–6 | year = 1987 | pmid = 3814386 | doi=10.1001/archotol.1987.01860040036012}}