cefpimizole

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 444707809

| IUPAC_name = 2-[1-([(6R,7R)-2-carboxy-7-([(2R)-2-[(5-carboxy1H-imidazole-4-carbonyl)amino]-2-phenylacetyl]amino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl)pyridin-1-ium-4-yl]ethanesulfonate

| image = Cefpimizole.svg

| width = 280

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 84880-03-5

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 2103902

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 24S58UHU7N

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D03427

| PubChem = 11765031

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 61863

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H26N6O10S2/c35-23(18(16-4-2-1-3-5-16)31-24(36)19-20(27(38)39)30-14-29-19)32-21-25(37)34-22(28(40)41)17(13-45-26(21)34)12-33-9-6-15(7-10-33)8-11-46(42,43)44/h1-7,9-10,14,18,21,26H,8,11-13H2,(H5-,29,30,31,32,35,36,38,39,40,41,42,43,44)/t18-,21-,26-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = LNZMRLHZGOBKAN-KAWPREARSA-N

| chemical_formula =

| C=28 | H=26 | N=6 | O=10 | S=2

| smiles = C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)NC(=O)C4=C(N=CN4)C(=O)O)C(=O)[O-])C[N+]5=CC=C(C=C5)CCS(=O)(=O)O

}}

Cefpimizole (INN) is a third-generation cephalosporin antibiotic.

References

  • {{cite journal | vauthors = Hara K, Shimada J | title = [New antimicrobial agent series XXI: Cefpimizole] | language = ja | journal = The Japanese Journal of Antibiotics | volume = 40 | issue = 6 | pages = 1108–22 | date = June 1987 | pmid = 3312705 }}