ceftezole

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| IUPAC_name = (6R,7R)-8-oxo-7-{[2-(tetrazol-1-yl)acetyl]amino}-
3-(1,3,4-thiadiazol-2-ylsulfanylmethyl)-5-thia-
1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = ceftezole.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 26973-24-0

| ATC_prefix = J01

| ATC_suffix = DB12

| ChEMBL = 1697829

| PubChem = 65755

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 59178

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2Z86SYP11W

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07656

| C=13 | H=12 | N=8 | O=4 | S=3

| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)Cn3nnnc3)CSc4nncs4)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C13H12N8O4S3/c22-7(1-20-4-14-18-19-20)16-8-10(23)21-9(12(24)25)6(2-26-11(8)21)3-27-13-17-15-5-28-13/h4-5,8,11H,1-3H2,(H,16,22)(H,24,25)/t8-,11-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = DZMVCVMFETWNIU-LDYMZIIASA-N

}}

Ceftezole (or ceftezol) is a semisynthetic first-generation cephalosporin antibiotic.{{cite book | vauthors = Berger SA |title=GIDEON Guide to Antimicrobial Agents |date=2021 |publisher=Gideon Informatics, Incorporated |location=Los Angeles |isbn=978-1-4988-2958-8 |page=301 | chapter = Ceftezole | chapter-url=https://books.google.com/books?id=4ko-EAAAQBAJ&dq=Ceftezole&pg=PA301}}

Ceftezole binds to and inactivates penicillin-binding proteins (PBPs) located on the inner membrane of the bacterial cell wall. PBPs are enzymes involved in the terminal stages of assembling the bacterial cell wall and in reshaping the cell wall during growth and division. Inactivation of PBPs interferes with the cross-linkage of peptidoglycan chains necessary for bacterial cell wall strength and rigidity. This results in the weakening of the bacterial cell wall and causes cell lysis.{{cn|date=January 2023}}

Ceftezole is having (1,3,4-thiadiazol-2-ylsulfanyl)methyl and [2-(1H-tetrazol-1-yl)acetamido side groups located at positions 3 and 7 respectively. It is a cephalosporin and a member of thiadiazoles.{{cn|date=January 2023}}

References

{{Reflist}}

Note

  • {{Include-USGov

|agency=National Center for Biotechnology Information - the National Library of Medicine - PubChem®

|article=Ceftezole (compound)

|url=https://pubchem.ncbi.nlm.nih.gov/compound/Ceftezole}}