ceftiolene

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 444283882

| IUPAC_name = (6R,7R)-7-([(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino)-3-[(E)-2-([5,6-dioxo-4-(2-oxoethyl)-1H-1,2,4-triazin-3-yl]sulfanyl)ethenyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid

| image = Ceftiolene.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 77360-52-2

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 6537430

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEBI = 140116

| ChEMBL = 2106102

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 28TV2P33KF

| ChemSpiderID = 5020599

| StdInChI = 1S/C20H18N8O8S3/c1-36-26-10(9-7-39-19(21)22-9)13(30)23-11-15(32)28-12(18(34)35)8(6-38-17(11)28)2-5-37-20-25-24-14(31)16(33)27(20)3-4-29/h2,4-5,7,11,17H,3,6H2,1H3,(H2,21,22)(H,23,30)(H,24,31)(H,34,35)/b5-2+,26-10-/t11-,17-/m1/s1

| StdInChIKey = WJXAHFZIHLTPFR-JLRJEBFFSA-N

| chemical_formula =

| C=20 | H=18 | N=8 | O=8 | S=3

| smiles = CON=C(C1=CSC(=N1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C=CSC4=NNC(=O)C(=O)N4CC=O)C(=O)O

}}

Ceftiolene (INN) is a third-generation cephalosporin antibiotic.{{cite journal | vauthors = Williamson R, Gutmann L, Kitzis MD, Acar JF | title = An evaluation of the bacteriolytic and biochemical properties of ceftiolene (42980RP) | journal = The Journal of Antimicrobial Chemotherapy | volume = 14 | issue = 6 | pages = 581–93 | date = December 1984 | pmid = 6394571 | doi = 10.1093/jac/14.6.581 }}