cerium(IV) sulfate

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 476998090

| Name = Cerium(IV) sulfate

| ImageFile = Ceric sulfate.jpg

| ImageSize =

| ImageName = Cerium(IV) sulfate

| IUPACName =

| OtherNames = Ceric sulfate

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 140403

| InChI = 1/Ce.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+4;;/p-4

| SMILES = [Ce+4].[O-]S(=O)(=O)[O-].[O-]S([O-])(=O)=O

| InChIKey = VZDYWEUILIUIDF-XBHQNQODAK

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/Ce.2H2O4S/c;2*1-5(2,3)4/h;2*(H2,1,2,3,4)/q+4;;/p-4

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = VZDYWEUILIUIDF-UHFFFAOYSA-J

| CASNo = 13590-82-4

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 10294-42-5

| CASNo2_Comment = (tetrahydrate)

| PubChem = 159684

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4F66FI5T7X

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 6SAX34B8JE

| UNII1_Comment = (tetrahydrate)

}}

|Section2={{Chembox Properties

| Formula = Ce(SO₄)₂

| MolarMass = 332.24 g/mol (anhydrous)
404.304 (tetrahydrate)

| Appearance = Yellow solid (anhydrous)
yellow-orange crystals (tetrahydrate)

| Solubility = Soluble in small amounts, hydrolyzes in large amounts of water
21.4 g/100 mL (0 °C)
9.84 g/100 mL (20 °C)
3.87 g/100 mL (60 °C){{RubberBible87th}}

| SolubleOther = soluble in dilute sulfuric acid

| Density = 3.91 g/cm³ (tetrahydrate)

| MeltingPtC = 350

| MeltingPt_notes = (decomposes)

| BoilingPt = N/A

| pKa =

| MagSus = +37.0·10⁻⁶ cm³/mol

}}

|Section3={{Chembox Structure

| Coordination =

| CrystalStruct = orthorhombic

}}

|Section7={{Chembox Hazards

| ExternalSDS = [http://hazard.com/msds/mf/baker/baker/files/c1859.htm External MSDS]

| MainHazards = Oxidizer

}}

|Section8={{Chembox Related

| OtherAnions =

}}

}}

Cerium(IV) sulfate, also called ceric sulfate, is an inorganic compound. It exists as the anhydrous salt Ce(SO₄)₂ as well as a few hydrated forms: Ce(SO₄)₂(H₂O)_x, with x equal to 4, 8, or 12. These salts are yellow to yellow/orange solids that are moderately soluble in water and dilute acids. Its neutral solutions slowly decompose, depositing the light yellow oxide CeO₂. Solutions of ceric sulfate have a strong yellow color. The tetrahydrate loses water when heated to 180-200 °C.

It is insoluble in glacial acetic acid and pure (96%) ethanol.

It was historically produced by direct reaction of fine, calcined cerium (IV) oxide and concentrated sulfuric acid, yielding the tetrahydrate.