chloramine-T

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 477379059

| ImageFile = Chloramine T.svg

| ImageFile1 = Chloramine-T-3D-balls.png

| ImageAlt1 = Ball-and-stick model of the component ions of chloramine-T

| ImageFile2 = Chloramin T trihydrát.jpg

| ImageAlt2 = Chloramine-T trihydrate

| PIN = Sodium chloro(4-methylbenzene-1-sulfonyl)azanide

| OtherNames = {{bulletedlist|N-Chloro-para-toluenesulfonylamide|Sodium N-chloro-4-methylbenzenesulphonomite|Chloraseptin|Chlorazol|Clorina|Disifin|Halamid|Hydroclonazone|Trichlorol|Minachlor|Tosylchloramide Sodium|N-chlorotosylamide, sodium salt}}

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2876055

| ChemSpiderID2_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID2 = 29119

| ChemSpiderID2_Comment = (free acid)

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 328AS34YM6

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 =4IU6VSV0EI

| UNII1_Comment = (trihydrate)

| EINECS = 204-854-7

| InChI = 1/C7H7ClNO2S.Na/c1-6-2-4-7(5-3-6)12(10,11)9-8;/h2-5H,1H3;/q-1;+1

| InChIKey = VDQQXEISLMTGAB-UHFFFAOYAP

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 127-65-1

| CASNo2_Ref = {{cascite|correct|??}}

| CASNo2 = 7080-50-4

| CASNo2_Comment = (trihydrate)

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1697734

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 53782

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C7H8ClNO2S/c1-6-2-4-7(5-3-6)12(10,11)9-8/h2-5,9H,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NXTVQNIVUKXOIL-UHFFFAOYSA-N

| PubChem = 3641960

| PubChem2 = 31388

| PubChem2_Comment = (free acid)

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02445

| SMILES = [Na+].O=S(=O)([N-]Cl)c1ccc(cc1)C

}}

|Section2={{Chembox Properties

| Formula = C₇H₇ClNO₂S·Na
C₇H₇ClNO₂S·Na·(3H₂O) (hydrate)

| MolarMass = 227.64 g/mol
281.69 g/mol (trihydrate)

| Appearance = White powder

| Density = 1.4 g/cm³

| MeltingPt = Releases chlorine at

| MeltingPtC = 130

| MeltingPt_notes =
Solid melts at 167–169 °C

| BoilingPt =

| Solubility = >100 g/L (hydrate){{cite web | url = http://www.sigmaaldrich.com/catalog/product/sigma/c9887?lang=en | title = Chloramine-T hydrate | publisher = Sigma-Aldrich}}

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = D08

| ATCCode_suffix = AX04

| ATC_Supplemental = {{ATCvet|P53|AB04}}

}}

|Section7={{Chembox Hazards

| MainHazards = Corrosive

| GHSPictograms = {{GHS05}}{{GHS07}}{{GHS08}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|302|314|334}}

| PPhrases = {{P-phrases|260|261|264|270|280|285|301+312|301+330+331|303+361+353|304+340|304+341|305+351+338|310|321|330|342+311|363|405|501}}

| FlashPt =

| AutoignitionPt =

}}

}}

Chloramine-T is the organic compound with the formula CH₃C₆H₄SO₂NClNa. Both the anhydrous salt and its trihydrate are known. Both are white powders. Chloramine-T is used as a reagent in organic synthesis.{{cite journal|doi=10.1021/cr60311a005|title=Chloramine T and Related N-halogeno-N-metallo reagents|journal=Chemical Reviews|volume=78|pages=65–79|year=1978|last1=Campbell|first1=Malcolm M.|last2=Johnson|first2=Graham.}} It is commonly used as cyclizing agent in the synthesis of aziridine, oxadiazole, isoxazole and pyrazoles.{{Cite journal |last1=Nayak |first1=Yogeesha N. |last2=Gaonkar |first2=Santosh L. |last3=Saleh |first3=Ebraheem Abdu Musad |last4=Dawsari |first4=Abdullah Mohammed A. L. |last5=Harshitha |last6=Husain |first6=Kakul |last7=Hassan |first7=Ismail |date=2022-03-01 |title=Chloramine-T (N-chloro-p-toluenesulfonamide sodium salt), a versatile reagent in organic synthesis and analytical chemistry: An up to date review |journal=Journal of Saudi Chemical Society |language=en |volume=26 |issue=2 |pages=101416 |doi=10.1016/j.jscs.2021.101416 |issn=1319-6103|doi-access=free }} It's inexpensive, has low toxicity and acts as a oxidizing agent. In addition, it also acts as a source of nitrogen anions and electrophilic cations. It may undergo degradation on long term exposure to atmosphere such that care must be taken during its storage.