chlorophyll d

{{DISPLAYTITLE:Chlorophyll d}}

{{Chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457796568

| ImageFile = Chlorophyll d structure.svg

| ImageSize = 300px

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|changed|??}}

| CASNo =

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 38199

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = QXWRYZIMSXOOPY-SKHCYZARSA-M

| PubChem = 6449882

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 519-63-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 60L1FX1O1U

| PubChem2 = 16070025

| ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID2 = 16736116

| SMILES2 = CC(C)CCC[C@@H](C)CCC[C@@H](C)CCCC(\C)=C\COC(=O)CC[C@H]6[C@H](C)C=5/C=C/2\N\1[Mg]n4c(\C=C\3/N=C(/C=C/1C(\C=O)=C\2\C)C(/C)=C/3/CC)c(C)c7c4\C(=C6/N=5)[C@@H](C(=O)OC)C7=O

| InChI2 = 1S/C54H71N4O6.Mg/c1-12-38-34(7)42-27-46-40(29-59)36(9)41(56-46)26-43-35(8)39(51(57-43)49-50(54(62)63-11)53(61)48-37(10)44(58-52(48)49)28-45(38)55-42)22-23-47(60)64-25-24-33(6)21-15-20-32(5)19-14-18-31(4)17-13-16-30(2)3;/h24,26-32,35,39,50H,12-23,25H2,1-11H3,(H-,55,56,57,58,59,61);/q-1;+2/p-1/b33-24+;/t31-,32-,35+,39+,50-;/m1./s1

}}

|Section2={{Chembox Properties

| Formula = C₅₄H₇₀MgO₆N₄

| MolarMass =

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Chlorophyll d (Chl d) is a form of chlorophyll, identified by Harold Strain and Winston Manning in 1943.{{cite journal | vauthors = Manning WM, Strain HH | title = Chlorophyll d, a green pigment of red algae. | journal = Journal of Biological Chemistry | date = November 1943 | volume = 151 | issue = 1 | pages = 1–9 | doi = 10.1016/S0021-9258(18)72109-1 | url = http://www.jbc.org/content/151/1/1.full.pdf | doi-access = free }} It was unambiguously identified in Acaryochloris marina in the 1990s.{{cite journal | first1 = Anthony W.D. | last1 = Larkum | first2 = Michael | last2 = Kühl | name-list-style = vanc | title = Chlorophyll d: the puzzle resolved | journal = Trends in Plant Science | volume = 10 | issue = 8 | pages = 355–7 | date = August 2005 | url = http://www.mbl.ku.dk/mkuhl/pages/PDF/Larkum%26Kuhl_2005.pdf | doi = 10.1016/j.tplants.2005.06.005 | pmid = 16019251 | access-date = 2014-11-17 | archive-date = 2012-03-13 | archive-url = https://web.archive.org/web/20120313121156/http://www.mbl.ku.dk/mkuhl/pages/PDF/Larkum%26Kuhl_2005.pdf | url-status = dead }} It is present in cyanobacteria which use energy captured from sunlight for photosynthesis.{{cite web|title=Photosynthetic Pigments|url=http://www.ucmp.berkeley.edu/glossary/gloss3/pigments.html | publisher = University of California Museum of Paleontology }} Chl d absorbs far-red light, at 710 nm wavelength, just outside the optical range.{{cite web|title=Scientists discover first new chlorophyll in 60 years|url=http://www.physorg.com/news201502581.html|website=PHYS ORG|date=August 20, 2010}} An organism that contains Chl d is adapted to an environment such as moderately deep water, where it can use far red light for photosynthesis,{{cite news|url=http://www.news-medical.net/news/2008/02/08/35091.aspx|title=Researchers decode genetics of chlorophyll d|website=News Medical Life Sciences|publisher=AZO Network}} although there is not a lot of visible light.{{cite web | title = Chlorophyll d | work = Biology Online| date = 7 October 2019|url=http://www.biology-online.org/dictionary/Chlorophyll_d}}

Chl d is produced from chlorophyllide d by chlorophyll synthase. Chlorophyllide d is made from chlorophyllide a, but the oxygen-using enzyme that performs this conversion remains unknown as of 2022.{{cite journal |last1=Tsuzuki |first1=Yuki |last2=Tsukatani |first2=Yusuke |last3=Yamakawa |first3=Hisanori |last4=Itoh |first4=Shigeru |last5=Fujita |first5=Yuichi |last6=Yamamoto |first6=Haruki |title=Effects of Light and Oxygen on Chlorophyll d Biosynthesis in a Marine Cyanobacterium Acaryochloris marina |journal=Plants |date=29 March 2022 |volume=11 |issue=7 |pages=915 |doi=10.3390/plants11070915|pmid=35406896 |pmc=9003380 |doi-access=free }}

class="wikitable" style="margin:1em auto; text-align:center;" | 200px	200px
Ball-and-stick model	Space-filling model