chlorphenoxamine

{{Short description|Chemical compound}}

{{Drugbox

|Verifiedfields = changed

|Watchedfields = changed

|verifiedrevid = 447811372

|IUPAC_name = {2-[1-(4-chlorophenyl)-1-phenylethoxy]ethyl}dimethylamine

|image = Chlorphenoxamine.svg

|Drugs.com = {{drugs.com|international|chlorphenoxamine}}

|routes_of_administration = Oral, topical

|bioavailability = Well absorbed

|metabolism = Likely liver

|excretion = kidney

|CAS_number_Ref = {{cascite|correct|??}}

|CAS_number = 77-38-3

|CAS_supplemental = {{CAS|562-09-4}}

|ATC_prefix = D04

|ATC_suffix = AA34

|ATC_supplemental = {{ATC|R06|AA06}}

|PubChem = 6475

|DrugBank_Ref = {{drugbankcite|changed|drugbank}}

|DrugBank = DB09007

|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

|ChemSpiderID = 6230

|ChEMBL_Ref = {{ebicite|changed|EBI}}

|ChEMBL = 2110774

|UNII_Ref = {{fdacite|correct|FDA}}

|UNII = 3UVD77BP8R

|KEGG_Ref = {{keggcite|correct|kegg}}

|KEGG = D07198

|C=18 | H=22 | Cl=1 | N=1 | O=1

|smiles = Clc1ccc(cc1)C(OCCN(C)C)(c2ccccc2)C

|StdInChI_Ref = {{stdinchicite|correct|chemspider}}

|StdInChI = 1S/C18H22ClNO/c1-18(21-14-13-20(2)3,15-7-5-4-6-8-15)16-9-11-17(19)12-10-16/h4-12H,13-14H2,1-3H3

|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

|StdInChIKey = KKHPNPMTPORSQE-UHFFFAOYSA-N

}}

Chlorphenoxamine (Phenoxene) is an antihistamine and anticholinergic used as an antipruritic{{cite journal | vauthors = Bazex A, Dupre A, Christol B | title = [Trial treatment of urticaria with chlorphenoxamine] | journal = Clinique | volume = 58 | pages = 447–50 | year = 1963 | pmid = 13967113 }} and antiparkinsonian{{cite journal | vauthors = Uldall PR, Walton JN, Newell DJ | title = Chlorphenoxamine hydrochloride in parkinsonism. A controlled trial | journal = British Medical Journal | volume = 1 | issue = 5240 | pages = 1649–52 | date = June 1961 | pmid = 13779077 | pmc = 1954253 | doi = 10.1136/bmj.1.5240.1649 }} agent. It is an analog of diphenhydramine.{{cite journal | vauthors = Arnold H, Brock N, Kuhas E, Lorenz D | title = Beitrag Zur Wirkung Von Antihistamin-Substanzen. 1. Chemische Konstitution Und Pharmakologische Wirkung in Der Gruppe Der Basischen Benzhydrylaether | trans-title = Contribution to the Effect Of Antihistamine Substances. 1. Chemical constitution and pharmacological activity in the group of basic benzhydrylethers | journal = Arzneimittel-Forschung | trans-journal = Drug Research | language = German | date = January 1954 | volume = 4 | issue = 3 | pages = 189–94 | pmid = 13159698 }}