chloryl tetraperchloratoaurate

{{Chembox

| Reference =

| Name =

| IUPACName =

| PIN =

| SystematicName =

| OtherNames = {{Unbulleted list|Gold(III) perchlorate dichlorine hexoxide}}

| data page pagename =

| ImageFile =

| ImageSize =

| ImageAlt =

| ImageName =

| ImageCaption =

| ImageFile1 =

| ImageSize1 =

| ImageAlt1 =

| ImageName1 =

| ImageCaption1 =

| ImageFileL1 =

| ImageSizeL1 =

| ImageAltL1 =

| ImageNameL1 =

| ImageFileR1 =

| ImageSizeR1 =

| ImageAltR1 =

| ImageNameR1 =

| Section1 = {{Chembox Identifiers

| CASNo = 453509-25-6

| CASNo_Ref = {{cascite|correct|CAS}}

| StdInChI=1S/Au.4ClHO4.ClO2/c;4*2-1(3,4)5;2-1-3/h;4*(H,2,3,4,5);/q+3;;;;;+1/p-4

| StdInChIKey=ACLJBRMVWTXQHV-UHFFFAOYSA-J

| SMILES = O=Cl[O+].O=Cl(=O)(=O)[O-][Au+3]([O-]Cl(=O)(=O)=O)([O-]Cl(=O)(=O)=O)[O-]Cl(=O)(=O)=O

| UNNumber =

}}

| Section2 = {{Chembox Properties

| Appearance = Orange crystals{{cite journal |author1=Frédérique Cunin |author2=Catherine Deudon |author3=Frédéric Favier |author4=Bernard Mula |author5=Jean Louis Pascal |title=First Anhydrous Gold Perchlorato Complex: ClO2Au(ClO4)4. Synthesis and Molecular and Crystal Structure Analysis |journal=Inorganic Chemistry |date=2002 |volume=41 |issue=16 |pages=4173–4178 |doi=10.1021/ic020161z |language=en}}

| BoilingPtC =

| BoilingPt_ref =

| BoilingPt_notes=

| Density = 3.18 g/cm³

| Formula = {{chem2|[ClO2][Au(ClO4)4]}}

| MolarMass = 662.22 g/mol

| MeltingPtC = 48

| MeltingPt_ref =

| MeltingPt_notes= (decomposes)

| Solubility = Reacts

| SolubleOther =

| Solvent =

}}

| Section3 = {{Chembox Structure

| Coordination =

| CrystalStruct = monoclinic

| MolShape =

}}

| Section4 = {{Chembox Thermochemistry

| DeltaGf =

| DeltaHc =

| DeltaHf =

| Entropy =

| HeatCapacity =

}}

| Section7 = {{Chembox Hazards

| LD50 =

| LC50 =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-I =

| NFPA-S =

| PEL =

| REL =

| ExternalSDS =

| GHSPictograms =

| GHSSignalWord =

| HPhrases =

| PPhrases =

}}

| Section9 = {{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Chloryl tetraperchloratoaurate is an inorganic chemical compound with the formula {{chem2|[ClO2]+[Au(ClO4)4]-}} consisting of the chloryl cation and a tetraperchloratoaurate(III) anion. It is an orange solid that readily hydrolyzes in air.