ciclonicate

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 447891800

| IUPAC_name = trans-3,3,5-Trimethylcyclohexyl pyridine-3-carboxylate

| image = Ciclonicate.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 53449-58-4

| ATC_prefix = C04

| ATC_suffix = AC07

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChEMBL = 2104521

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7H634NXI03

| PubChem = 10444661

| ChemSpiderID = 8620080

| smiles = O=C(O[C@@H]1C[C@@H](C)CC(C)(C)C1)c2cccnc2

| StdInChI = 1S/C15H21NO2/c1-11-7-13(9-15(2,3)8-11)18-14(17)12-5-4-6-16-10-12/h4-6,10-11,13H,7-9H2,1-3H3/t11-,13-/m1/s1

| StdInChIKey = GQSGZTBDVNUIQS-DGCLKSJQSA-N

| C=15 | H=21 | N=1 | O=2

}}

Ciclonicate is a vasodilator.{{cite journal |vauthors=Gregoratti L, Crespi B, Groothold G, Fuligni E, Ghiringhelli L | title = Treatment of arteriosclerotic peripheral vascular diseases with ciclonicate | journal = Minerva Cardioangiologica | year = 1982 | volume = 30 | issue = 11 | pages = 659–668 | pmid = 7155375}}