ciladopa

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 2-{4-[(2S)-2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]piperazin-1-yl}cyclohepta-2,4,6-trien-1-one

| image = Ciladopa Structure.svg

| tradename =

| pregnancy_category =

| legal_status = Uncontrolled

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 80109-27-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 133371

| ChEMBL = 2110793

| ChemSpiderID = 117659

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D09L486R3J

| synonyms = AY-27,110

| C=21 | H=26 | N=2 | O=4

| SMILES = O=C3/C=C\C=C/C=C3/N2CCN(C[C@@H](O)c1ccc(OC)c(OC)c1)CC2

}}

Ciladopa (developmental code name AY-27,110) is a dopamine agonist with a similar chemical structure to dopamine.{{cite journal | author = Voith K | title = The comparative long-term effects of ciladopa (AY-27,110), a chemically novel dopaminergic agonist, in 6-OHDA-lesioned and intact rats | journal = Psychopharmacology | volume = 85 | issue = 4 | pages = 405–9 | year = 1985 | pmid = 3927334 | doi = 10.1007/BF00429654| s2cid = 1573473 }} It was under investigation as an antiparkinsonian agent but was discontinued due to concerns of tumorogenesis in rodents.{{cite journal |vauthors=Koller WC, Fields JZ, Gordon JH, Perlow MJ | title = Evaluation of ciladopa hydrochloride as a potential anti-Parkinson drug | journal = Neuropharmacology | volume = 25 | issue = 9 | pages = 973–9 |date=September 1986 | pmid = 3774130 | doi = 10.1016/0028-3908(86)90190-5| s2cid = 19175441 }}{{cite journal |vauthors=Weiner WJ, Factor SA, Sanchez-Ramos J, Berger J | title = A double-blind evaluation of ciladopa in Parkinson's disease | journal = Movement Disorders | volume = 2 | issue = 3 | pages = 211–7 | year = 1987 | pmid = 3332914 | doi = 10.1002/mds.870020308 | s2cid = 31784301 }}{{cite journal |vauthors=Lieberman A, Gopinathan G, Neophytides A, Pasternack P, Goldstein M | title = Advanced Parkinson's disease: use of partial dopamine agonist, ciladopa | journal = Neurology | volume = 37 | issue = 5 | pages = 863–5 |date=May 1987 | pmid = 3574692 | doi = 10.1212/wnl.37.5.863| s2cid = 25273606 }}{{cite journal | author = Lang AE | title = Update on dopamine agonists in Parkinson's disease: "beyond bromocriptine" | journal = The Canadian Journal of Neurological Sciences | volume = 14 | issue = 3 Suppl | pages = 474–82 |date=August 1987 | doi = 10.1017/s031716710003794x | pmid = 3315148 | doi-access = free }}