cinamolol

{{short description|Chemical compound}}

{{Infobox drug

| drug_name =

| IUPAC_name = Methyl (2E)-3-{2-[2-hydroxy-3-(isopropylamino)propoxy]phenyl}acrylate

| image = Cinamolol.svg

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 39099-98-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 7531Q8398Y

| ATCvet =

| ATC_prefix = none

| ATC_suffix =

| PubChem = 6443797

| ChEMBL = 1742425

| ChemSpiderID = 4947759

| DrugBank =

| C=16 | H=23 | N=1 | O=4

| smiles = CC(C)NCC(COC1=CC=CC=C1/C=C/C(=O)OC)O

| StdInChI = 1S/C16H23NO4/c1-12(2)17-10-14(18)11-21-15-7-5-4-6-13(15)8-9-16(19)20-3/h4-9,12,14,17-18H,10-11H2,1-3H3/b9-8+

| StdInChIKey = LWRSDAUWAOJRPA-CMDGGOBGSA-N

}}

Cinamolol is a beta blocker.{{cite book | vauthors = Morton IK, Hall JM | title = Concise Dictionary of Pharmacological Agents: Properties and Synonyms | page = 77 | publisher = Springer | year = 1999}}