cinchocaine
{{Short description|Local anaesthetic drug}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 460037677
| IUPAC_name = 2-butoxy-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide
| image = Cinchocaine.svg
| image2 = Cinchocaine 3D ball-and-stick.png
| tradename =
| Drugs.com = {{drugs.com|international|cinchocaine}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US = OTC
| legal_status =
| routes_of_administration = topical, intravenous (for animal euthanasia)
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 7159
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 85-79-0
| ATC_prefix = C05
| ATC_suffix = AD04
| ATC_supplemental = {{ATC|D04|AB02}} {{ATC|N01|BB06}} {{ATC|S01|HA06}} {{ATC|S02|DA04}}
| PubChem = 3025
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00527
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2917
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = L6JW2TJG99
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00733
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 247956
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1086
| C=20 | H=29 | N=3 | O=2
| smiles = O=C(c1c2ccccc2nc(OCCCC)c1)NCCN(CC)CC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C20H29N3O2/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PUFQVTATUTYEAL-UHFFFAOYSA-N
}}
Cinchocaine (INN/BAN) or dibucaine (USAN) is an amide local anesthetic. Among the most potent and toxic of the long-acting local anesthetics, current use of cinchocaine is generally restricted to spinal and topical anesthesia.Martindale, The Extra Pharmacopoeia, 30th ed, p1006{{cite web | url = https://meshb.nlm.nih.gov/record/ui?ui=D003992 | title = Dibucaine | work = MeSH Browser | publisher = U.S. National Library of Medicine }} It is sold under the brand names Cincain, Nupercainal, Nupercaine and Sovcaine.
Medical use
Cinchocaine is the active ingredient in some topical hemorrhoid creams such as Proctosedyl.{{Cite web | vauthors = Henderson R | date = 29 November 2020 | url=https://www.netdoctor.co.uk/medicines/digestion/a7401/proctosedyl-ointment-suppositories-cinchocaine-hydrocortisone/ | title=Proctosedyl ointment/suppositories (cinchocaine, hydrocortisone) | publisher = Netdoctor | access-date=25 December 2019}} It is also a component of the veterinary drug Somulose, used for euthanasia of horses and cattle.
Physical properties
See also
References
{{reflist}}
Further reading
{{refbegin}}
- {{cite journal | vauthors = Abdel-Ghani NT, Youssef AF, Awady MA | title = Cinchocaine hydrochloride determination by atomic absorption spectrometry and spectrophotometry | journal = Farmaco | volume = 60 | issue = 5 | pages = 419–424 | date = May 2005 | pmid = 15910814 | doi = 10.1016/j.farmac.2005.03.001 }}
- {{cite journal | vauthors = Souto-Padrón T, Lima AP, ((Ribeiro Rd)) | title = Effects of dibucaine on the endocytic/exocytic pathways in Trypanosoma cruzi | journal = Parasitology Research | volume = 99 | issue = 4 | pages = 317–320 | date = September 2006 | pmid = 16612626 | doi = 10.1007/s00436-006-0192-1 | s2cid = 5933459 }}
- {{cite journal | vauthors = Nounou MM, El-Khordagui LK, Khalafallah N | title = Effect of various formulation variables on the encapsulation and stability of dibucaine base in multilamellar vesicles | journal = Acta Poloniae Pharmaceutica | volume = 62 | issue = 5 | pages = 369–379 | year = 2005 | pmid = 16459486 }}
- {{cite journal | vauthors = Aroti A, Leontidis E | title = Simultaneous Determination of the Ionization Constant and the Solubility of Sparingly Soluble Drug Substances. A Physical Chemistry Experiment. | journal = Journal of Chemical Education| volume = 78 | issue = 6 | pages = 786–788 | year = 2001 | doi = 10.1021/ed078p786 | bibcode = 2001JChEd..78..786A }}
{{refend}}
{{Vasoprotectives}}
{{Antipruritics}}
{{local anesthetics}}
Category:Diethylamino compounds
{{dermatologic-drug-stub}}
{{nervous-system-drug-stub}}