cipralisant

{{Short description|Chemical compound}}

{{redirect|Perceptin|the robotics company PerceptIn|Robotic vacuum cleaner}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 407868696

| IUPAC_name = 5-[(1S,2S)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole

| image = Cipralisant structure.svg

| width = 280px

| tradename =

| routes_of_administration =

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 213027-19-1

| ATC_prefix = none

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 309713XSKW

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 278462

| PubChem = 10512919

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8688320

| smiles = CC(C)(C)CCC#C[C@H]1C[C@@H]1c2cnc[nH]2

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C14H20N2/c1-14(2,3)7-5-4-6-11-8-12(11)13-9-15-10-16-13/h9-12H,5,7-8H2,1-3H3,(H,15,16)/t11-,12-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CVKJAXCQPFOAIN-RYUDHWBXSA-N

| C=14 | H=20 | N=2

}}

Cipralisant (GT-2331, tentative trade name Perceptin) is an extremely potent histamine H3 receptor ligand originally developed by Gliatech.{{cite journal | vauthors = Ito S, Yoshimoto R, Miyamoto Y, Mitobe Y, Nakamura T, Ishihara A, MacNeil DJ, Kanatani A, Tokita S | display-authors = 6 | title = Detailed pharmacological characterization of GT-2331 for the rat histamine H3 receptor | journal = European Journal of Pharmacology | volume = 529 | issue = 1–3 | pages = 40–46 | date = January 2006 | pmid = 16316645 | doi = 10.1016/j.ejphar.2005.10.066 }} Cipralisant was initially classified as a selective H3 antagonist,{{cite journal | vauthors = Tedford CE, Hoffmann M, Seyedi N, Maruyama R, Levi R, Yates SL, Ali SM, Phillips JG | display-authors = 6 | title = High antagonist potency of GT-2227 and GT-2331, new histamine H3 receptor antagonists, in two functional models | journal = European Journal of Pharmacology | volume = 351 | issue = 3 | pages = 307–311 | date = June 1998 | pmid = 9721022 | doi = 10.1016/S0014-2999(98)00396-3 | doi-access = free }} but newer research (2005) suggests also agonist properties, i.e., functional selectivity.

The relatively recent cloning of human H3 receptor, as well as the discovery of its constitutive activity provided the ability to better assess the activity of H3 receptor ligands. Consequently, cipralisant was reassessed as an H3 receptor agonist in human and rat recombinant systems, showing functional selectivity and stimulating one type of G-protein coupled pathway while failing to activate other intracellular pathways.{{cite journal | vauthors = Krueger KM, Witte DG, Ireland-Denny L, Miller TR, Baranowski JL, Buckner S, Milicic I, Esbenshade TA, Hancock AA | display-authors = 6 | title = G protein-dependent pharmacology of histamine H3 receptor ligands: evidence for heterogeneous active state receptor conformations | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 314 | issue = 1 | pages = 271–281 | date = July 2005 | pmid = 15821027 | doi = 10.1124/jpet.104.078865 | s2cid = 20470970 }}

Gliatech filed for bankruptcy in 2002, and its intellectual property was inherited by Merck. The development of cipralisant seems to have been suspended since 2003 but research is ongoing, and recently it has been shown that it is the (1S,2S)-enantiomer which is the biologically active one.{{cite journal | vauthors = Liu H, Kerdesky FA, Black LA, Fitzgerald M, Henry R, Esbenshade TA, Hancock AA, Bennani YL | display-authors = 6 | title = An efficient multigram synthesis of the potent histamine H3 antagonist GT-2331 and the reassessment of the absolute configuration | journal = The Journal of Organic Chemistry | volume = 69 | issue = 1 | pages = 192–194 | date = January 2004 | pmid = 14703397 | doi = 10.1021/jo035264t }}

References

{{reflist}}

{{Histaminergics}}

Category:Cyclopropanes

Category:Histamine agonists

Category:Imidazoles

{{nervous-system-drug-stub}}