citenamide

{{Short description|Anticonvulsant}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Citenamide

| image = Citenamide.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 10423-37-7

| CAS_supplemental =

| PubChem = 25255

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 23588

| UNII = 17NZ10DWW0

| KEGG = D03527

| ChEBI =

| ChEMBL = 2104133

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = 5H-Dibenzo[a,d]cycloheptene-5-carboxamide, Cytenamide, AY-15,613.

| IUPAC_name = tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaene-2-carboxamide

| C=16 | H=13 | N=1 | O=1

| SMILES = C1=CC=C2C(C3=CC=CC=C3C=CC2=C1)C(=O)N

| StdInChI = 1S/C16H13NO/c17-16(18)15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-10,15H,(H2,17,18)

| StdInChIKey = HXQAPLNYYFQSFU-UHFFFAOYSA-N

}}

Citenamide is a tricyclic chemical agent that is very similar in character to and most closely resembles carbamazepine (Tegretol), which a non-addictive anticonvulsant agent used to treat epileptic seizures, schizophrenia, phantom limb pain and alcoholism. Citenamide contains an amide functional group whereas carbamazepine contains a urea. Citenamide is an old drug and there is little pharmacological data surrounding its use in medicine.{{cite journal | vauthors = Wilhelm M, Schmidt P | title = [Synthesis and properties of 1-aminoalkyl-dibenzo(b,e)bicyclo(2,2,2) octadienes] | journal = Helvetica Chimica Acta | volume = 52 | issue = 6 | pages = 1385–1395 | date = January 1969 | pmid = 5820776 | doi = 10.1002/hlca.19690520602 }}{{cite journal | vauthors = Davis MA, Winthrop SO, Thomas RA, Herr F, Charest MP, Gaudry R | title = Anticonvulsants. I. Dibenzo[a,d]cycloheptadiene-5-carboxamide and Related Compounds | journal = Journal of Medicinal Chemistry | volume = 7 | issue = 1 | pages = 88–94 | date = January 1964 | pmid = 14186033 | doi = 10.1021/jm00331a019 }}{{cite patent | inventor = Leonard F, Gagneux A | country = US | number = 3287409 | gdate = 1966 | assign = Novartis Corp | url = https://patents.google.com/patent/US3287409A/en?oq=US3287409 }}{{cite journal | vauthors = Frigerio A, Lanzoni J, Pantarotto C, Rossi E, Rovei V, Zanol M | title = Epoxide-diol metabolic pathway of cytenamide in the rat | journal = Journal of Chromatography | volume = 134 | issue = 2 | pages = 299–305 | date = April 1977 | pmid = 858759 | doi = 10.1016/S0021-9673(00)88526-X }}

Synthesis

File:Citenamide synthesis.svg

Organometallic formation between 5-chlorodibenzosuberene [18506-04-2] (1) and butyl lithium, is proceeded by a dry ice quench to give the acid, PC12515652{{Cite web | title = 5H-dibenzo[a,d]cycloheptene-5-carboxylic acid | url = https://pubchem.ncbi.nlm.nih.gov/compound/12515652 | work = PubChem | publisher = U.S. National Library of Medicine }} (2). Halogenation with thionyl chloride and Schotten-Baumann reaction with ammonia gives the amide, and hence citenamide (3).

References

{{Reflist}}

{{Anticonvulsants}}

{{Tricyclics}}

Category:Anticonvulsants

Category:Dibenzocycloheptenes

Category:Amides