clefamide

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443529583

| IUPAC_name = 2,2-Dichloro-N-(2-hydroxyethyl)-N-[[4-(4-nitrophenoxy)phenyl]methyl]

| image = clefamide.png

| tradename = Mebinol

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 3576-64-5

| ATC_prefix = P01

| ATC_suffix = AC02

| PubChem = 71819

| ChEMBL = 1788400

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 64843

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 4AZ2V8K4EK

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07354

| C=17 | H=16 | Cl=2 | N=2 | O=5

| smiles = ClC(Cl)C(=O)N(CCO)Cc2ccc(Oc1ccc(cc1)[N+]([O-])=O)cc2

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H16Cl2N2O5/c18-16(19)17(23)20(9-10-22)11-12-1-5-14(6-2-12)26-15-7-3-13(4-8-15)21(24)25/h1-8,16,22H,9-11H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ODCUSWJXZDHLKV-UHFFFAOYSA-N

}}

Clefamide (trade name Mebinol) is an antiprotozoal agent that was used to treat amoebiasis in the 1960s.{{cite journal | vauthors = Rodrigues LD, Jafferian PA, Vilella M, Costa AA, de Mello EB | title = [Comparative study on 3 amebicides: teclozine, clefamide and a combination of clefamide and iodo-chloro-oxyquinolines and streptomycin] | journal = Hospital | volume = 74 | issue = 5 | pages = 1563–73 | date = November 1968 | pmid = 5305335 }} There is no evidence for any later use of the drug.