cliropamine
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = Cliropamine.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class = Sympathomimetic; Positive inotrope
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 109525-44-2
| CAS_supplemental =
| PubChem = 193996
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 168337
| UNII = 87V8H2Q8IH
| KEGG =
| ChEBI =
| ChEMBL =
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = Clipoxamine; D-16427; D-16,427
| IUPAC_name = 5-[(1R,2S)-1-hydroxy-2-(3-phenylpropylamino)propyl]-2-methylphenol
| C=19 | H=25 | N=1 | O=2
| SMILES = CC1=C(C=C(C=C1)[C@H]([C@H](C)NCCCC2=CC=CC=C2)O)O
| StdInChI = 1S/C19H25NO2/c1-14-10-11-17(13-18(14)21)19(22)15(2)20-12-6-9-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,15,19-22H,6,9,12H2,1-2H3/t15-,19-/m0/s1
| StdInChIKey = AUTKZDGLQYYXLZ-KXBFYZLASA-N
}}
Cliropamine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code name D-16427) is a positive inotropic drug of the phenethylamine and amphetamine families which was never marketed.{{cite book | vauthors = Negwer M, Scharnow HG | title=Organic-chemical Drugs and Their Synonyms: An International Survey | publisher=Wiley-VCH | issue=v. 3 | year=2001 | isbn=978-3-527-30247-5 | url=https://books.google.com/books?id=zmpqAAAAMAAJ | access-date=27 February 2025 | page=1802 | quote=Cliropamine hydrochlo- ride ** , D - 16427 U Cardiotonic ( positive inotropic ) 8879 ( 7264 ) C19H25NO2 CH, 2- [Propyl(2-thienylethyl)amino]-5-hydroxytetralin-5,6,7,8-Tetrahydro-6-[propyl[2-(2-thienyl) ethyl] [...]}}{{cite web | title=CLIROPAMINE | website=Inxight Drugs | url=https://drugs.ncats.io/substance/87V8H2Q8IH | access-date=27 February 2025}}{{cite web | title = The use of stems in the selection of International Nonproprietary Names (INN) for pharmaceutical substances | date = 2004 | work = World Health Organization | location = Geneva | url = https://iris.who.int/bitstream/handle/10665/68742/WHO_EDM_QSM_2004.5.pdf}}{{cite journal | vauthors = Engel J, Bickel E, Klingler KH, Schönenberger H | title = [14C-labeling of D 16,427, a new positive inotropic agent] | language = German | journal = Arch Pharm (Weinheim) | volume = 319 | issue = 12 | pages = 1113–1116 | date = December 1986 | pmid = 2882738 | doi = 10.1002/ardp.19863191210 | url = }} It was first described by 1986.
References
{{Reflist}}
{{Adrenergic receptor modulators}}
{{Phenethylamines}}
Category:Beta-Hydroxyamphetamines
Category:3-Hydroxyphenyl compounds
{{Cardiovascular-drug-stub}}