clitocine

{{Chembox

| ImageFile = Clitocine.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (2R,3R,4S,5R)-2-[(6-Amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)oxolane-3,4-diol

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 105798-74-1

| PubChem = 129111

| ChemSpiderID = 114380

| SMILES = C1=NC(=C(C(=N1)N[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)[N+](=O)[O-])N}}

|Section2={{Chembox Properties

| C=9 | H=13 | N=5 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Clitocine is a mushroom nucleoside isolate{{cite journal | last1 = Kubo | first1 = Isao | last2 = Kim | first2 = Mujo | last3 = Wood | first3 = William F. | last4 = Naoki | first4 = Hideo | year = 1986 | title = Clitocine, A New Insecticidal Nucleoside From The Mushroom Clitocybe inversa | journal = Tetrahedron Letters | volume = 27 | issue = 36 | pages = 4277–4280 | doi=10.1016/S0040-4039(00)94251-5}} with anticancer activity in vitro.{{cite journal|title=Anti-proliferative effect of clitocine from the mushroom Leucopaxillus giganteus on human cervical cancer HeLa cells by inducing apoptosis|pmid=18222036 | doi=10.1016/j.canlet.2007.12.013 | volume=262|issue=2|date=April 2008|pages=190–200|last1=Ren |first1=Gang |last2=Zhao |first2=Yun-Peng |last3=Yang |first3=Lu |last4=Fu |first4=Cheng-Xin |journal=Cancer Letters }}{{cite journal|title=Clitocine reversal of P-glycoprotein associated multi-drug resistance through down-regulation of transcription factor NF-κB in R-HepG2 cell line|pmid=22927901 | doi=10.1371/journal.pone.0040720 | pmc=3425549|volume=7|issue=8|year=2012|journal=PLOS ONE|pages=e40720|last1=Sun |first1=Jianguo |last2=Yeung |first2=Chilam Au |last3=Co |first3=Ngai Na |last4=Tsang |first4=Tsun Yee |last5=Yau |first5=Esmond |last6=Luo |first6=Kewang |last7=Wu |first7=Ping |last8=Wa |first8=Judy Chan Yuet |last9=Fung |first9=Kwok-Pui |last10=Kwok |first10=Tim-Tak |last11=Liu |first11=Feiyan |bibcode=2012PLoSO...740720S |doi-access=free }}{{cite journal|title=Clitocine targets Mcl-1 to induce drug-resistant human cancer cell apoptosis in vitro and tumor growth inhibition in vivo|pmid=24563182 | doi=10.1007/s10495-014-0969-0 | volume=19|issue=5|date=May 2014|journal=Apoptosis|pages=871–82|last1=Sun |first1=Jian-guo |last2=Li |first2=Hua |last3=Li |first3=Xia |last4=Zeng |first4=Xueli |last5=Wu |first5=Ping |last6=Fung |first6=Kwok-Pui |last7=Liu |first7=Fei-yan |s2cid=14746593 }}