cloforex

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| IUPAC_name = ethyl N-[1-(4-chlorophenyl)-2-methylpropan-2-yl]carbamate

| image = Cloforex.svg

| alt = Skeletal formula

| image2 = Cloforex molecule spacefill.png

| alt2 = Space-filling model of cloforex

| tradename = Frenapyl, Lipociden, Oberex, Vidipon, Zeisin

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 14261-75-7

| ATC_prefix = none

| ATC_suffix =

| PubChem = 26602

| ChemSpiderID = 24781

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2QJT5ZC1L6

| ChEMBL = 1697686

| synonyms = Carbamic acid, N-[2-(4-chlorophenyl)-1,1-dimethylethyl]-, ethyl ester

| C = 13

| H = 18

| Cl = 1

| N = 1

| O = 2

| smiles = CCOC(=O)NC(C)(C)CC1=CC=C(C=C1)Cl

| melting_point = 89

| boiling_point = 52.75

}}

Cloforex (Oberex) is an anorectic of the amphetamine class.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 | url = https://books.google.com/books?id=5GpcTQD_L2oC&q=cloforex&pg=PA257}} It is a prodrug to chlorphentermine.{{cite book | vauthors = Dreyfuss J, Zimmerberg HY, Schreiber EC | chapter = Drug Metabolism. | veditors = Cain CK | title = Annual Reports in Medicinal Chemistry | volume = 6 | publisher = Academic Press | location = Boston | year = 1971 | pages = 205–214| isbn = 0-12-040506-7 | doi = 10.1016/S0065-7743(08)60975-6 | chapter-url = https://books.google.com/books?id=dBGM4WSV_YEC&q=cloforex&pg=PA211}} It never became a mass produced drug in part due to the side effects found in mice. Mice who consumed 75 mg of cloforex a day experienced weight loss along with pulmonary hypertension and hair loss.{{Cite journal|last=Woodward|first=Stephen C.|date=1981|title=Induction and reversal of pulmonary lipid histiocytosis in rats following oral administration of anorectics cloforex and chlorphentermine|url=http://www.tandfonline.com/doi/abs/10.1080/15287398109530002|journal=Journal of Toxicology and Environmental Health|language=en|volume=7|issue=3–4|pages=569–583|doi=10.1080/15287398109530002|pmid=7197305 |bibcode=1981JTEH....7..569W |issn=0098-4108}}