clogestone
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = 1-[(1S,2R,5S,10R,11S,14R,15S)-8-chloro-5,14-dihydroxy-2,15-dimethyltetracyclo[8.7.0.02,7.011,15]heptadeca-6,8-dien-14-yl]ethan-1-one
| image = Clogestone.svg
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 20047-75-0
| CAS_supplemental =
| ATC_prefix =
| ATC_suffix =
| PubChem = 20055454
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID_Ref =
| ChemSpiderID = 16736893
| UNII = 0I88K7V2TF
| C=21 | H=29 | Cl=1 | O=3
| smiles = CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(CCC34C)O)Cl)C)O
| StdInChI_Ref =
| StdInChI = 1S/C21H29ClO3/c1-12(23)21(25)9-6-16-14-11-18(22)17-10-13(24)4-7-19(17,2)15(14)5-8-20(16,21)3/h10-11,13-16,24-25H,4-9H2,1-3H3/t13-,14+,15-,16-,19+,20-,21-/m0/s1
| StdInChIKey_Ref =
| StdInChIKey = WZTUZRFSDWXDRM-IAGOJMRCSA-N
| synonyms = Chlormadinol
}}
Clogestone (INN, BAN), also known as chlormadinol or as 3β,17α-dihydroxy-6-chloropregna-4,6-diene-20-one,{{cite book| vauthors = Litwack G |title=Biochemical Actions of Hormones|url=https://books.google.com/books?id=et3Lq-TitzAC&pg=PA323|date=2 December 2012|publisher=Elsevier|isbn=978-0-323-15189-4|pages=323–}} is a steroidal progestin that was synthesized in 1964 and was investigated as a progestin-only contraceptive but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA297|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=297–}}{{cite book| vauthors = Hawkins DF, Elder MG |title=Human Fertility Control: Theory and Practice|url=https://books.google.com/books?id=1lL0AgAAQBAJ&pg=PA3|date=22 October 2013|publisher=Elsevier Science|isbn=978-1-4831-6361-1|pages=3–}} A diacetate ester, clogestone acetate, also exists and similarly was never marketed.
See also
References
{{Reflist}}
{{Progesterone receptor modulators}}
{{genito-urinary-drug-stub}}
{{steroid-stub}}