clogestone

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = 1-[(1S,2R,5S,10R,11S,14R,15S)-8-chloro-5,14-dihydroxy-2,15-dimethyltetracyclo[8.7.0.02,7.011,15]heptadeca-6,8-dien-14-yl]ethan-1-one

| image = Clogestone.svg

| width =

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 20047-75-0

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| PubChem = 20055454

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 16736893

| UNII = 0I88K7V2TF

| C=21 | H=29 | Cl=1 | O=3

| smiles = CC(=O)C1(CCC2C1(CCC3C2C=C(C4=CC(CCC34C)O)Cl)C)O

| StdInChI_Ref =

| StdInChI = 1S/C21H29ClO3/c1-12(23)21(25)9-6-16-14-11-18(22)17-10-13(24)4-7-19(17,2)15(14)5-8-20(16,21)3/h10-11,13-16,24-25H,4-9H2,1-3H3/t13-,14+,15-,16-,19+,20-,21-/m0/s1

| StdInChIKey_Ref =

| StdInChIKey = WZTUZRFSDWXDRM-IAGOJMRCSA-N

| synonyms = Chlormadinol

}}

Clogestone (INN, BAN), also known as chlormadinol or as 3β,17α-dihydroxy-6-chloropregna-4,6-diene-20-one,{{cite book| vauthors = Litwack G |title=Biochemical Actions of Hormones|url=https://books.google.com/books?id=et3Lq-TitzAC&pg=PA323|date=2 December 2012|publisher=Elsevier|isbn=978-0-323-15189-4|pages=323–}} is a steroidal progestin that was synthesized in 1964 and was investigated as a progestin-only contraceptive but was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA297|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=297–}}{{cite book| vauthors = Hawkins DF, Elder MG |title=Human Fertility Control: Theory and Practice|url=https://books.google.com/books?id=1lL0AgAAQBAJ&pg=PA3|date=22 October 2013|publisher=Elsevier Science|isbn=978-1-4831-6361-1|pages=3–}} A diacetate ester, clogestone acetate, also exists and similarly was never marketed.

See also

References

{{Reflist}}

{{Progesterone receptor modulators}}

Category:Organochlorides

Category:Pregnanes

Category:Progestogens

Category:Abandoned drugs

{{genito-urinary-drug-stub}}

{{steroid-stub}}