clometocillin
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = (2S,5R,6R)-6-([2-(3,4-dichlorophenyl)-2-methoxyacetyl]amino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
| image = Clometacillin.svg
| tradename =
| Drugs.com = {{drugs.com|international|clometocillin}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number = 1926-49-4
| ATC_prefix = J01
| ATC_suffix = CE07
| ChEBI = 131732
| ChEMBL = 2106548
| PubChem = 71807
| DrugBank =
| ChemSpiderID = 64831
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = YI8LL014GF
| KEGG = D07236
| C=17 | H=18 | Cl=2 | N=2 | O=5 | S=1
| smiles = O=C(O)[C@@H]2N3C(=O)[C@@H](NC(=O)C(OC)c1ccc(Cl)c(Cl)c1)[C@H]3SC2(C)C
}}
Clometocillin (or clometacillin) is a penicillin.{{cite journal | vauthors = Vanhoof R | title = Comparative in-vitro activities of amoxycillin and penicillin against Streptococcus pneumoniae isolates | journal = The Journal of Antimicrobial Chemotherapy | volume = 42 | issue = 3 | pages = 397–8 | date = September 1998 | pmid = 9786482 | doi = 10.1093/jac/42.3.397 | doi-access = free }}{{cite book |title=Pharmaceutical Manufacturing Encyclopedia |date=2007 |publisher=William Andrew Publishing |location=Norwich, N.Y. |isbn=978-0-8155-1856-3 |pages=1091 |edition=3rd | chapter = Clometocillin | chapter-url=https://books.google.com/books?id=_J2ti4EkYpkC&dq=Clometocillin&pg=PA1091}}
References
{{Reflist}}
{{Cell wall disruptive antibiotics}}
Category:Phenylethanolamine ethers
{{antibiotic-stub}}