clomifenoxide

{{short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (E,Z)-2-(p-(2-Chloro-1,2-diphenylvinyl)phenoxy)triethylamine N-oxide

| image = Clomifenoxide.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 97642-74-5

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| PubChem = 9979613

| ChemSpiderID = 8155205

| UNII = L88W2ZR0TI

| KEGG =

| ChEBI =

| ChEMBL =

| C=26 | H=28 | Cl=1 | N=1 | O=2

| SMILES = [N+](CCOc1ccc(cc1)C(=C(/c1ccccc1)Cl)\c1ccccc1)(CC)(CC)[O-]

| StdInChI_Ref =

| StdInChI = 1S/C26H28ClNO2/c1-3-28(29,4-2)19-20-30-24-17-15-22(16-18-24)25(21-11-7-5-8-12-21)26(27)23-13-9-6-10-14-23/h5-18H,3-4,19-20H2,1-2H3/b26-25-

| StdInChIKey_Ref =

| StdInChIKey = PGHWCZITRQNIPM-QPLCGJKRSA-N

| synonyms = Clomifene N-oxide

}}

Clomifenoxide (INN), also known as clomifene N-oxide, is a nonsteroidal selective estrogen receptor modulator (SERM) of the triphenylethylene group that is described as an antiestrogen and "gonad stimulant" and was never marketed.{{Cite book |url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA298 |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies |vauthors=Elks J |date=14 November 2014 |publisher=Springer |isbn=978-1-4757-2085-3 |pages=298–}}{{Cite book |url=https://books.google.com/books?id=1nBqAAAAMAAJ |title=Organic-chemical drugs and their synonyms: (an international survey) |vauthors=Negwer M, Scharnow HG |publisher=Wiley-VCH |year=2001 |isbn=978-3-527-30247-5 |page=3506}} It is an active metabolite of clomifene.{{Cite book |url=https://books.google.com/books?id=kia7bq8EM9IC&pg=PA113 |title=Analytical Profiles of Drug Substances and Excipients |date=20 March 1998 |publisher=Academic Press |isbn=978-0-08-086120-3 |pages=113–}}{{Cite book |url=https://books.google.com/books?id=luttauRomC8C&pg=SL3-PA148 |title=Handbook of Biotransformations of Aromatic Compounds |vauthors=Goodwin BL |date=10 November 2004 |publisher=CRC Press |isbn=978-0-203-64196-5 |pages=3–}}