cloperidone

{{Short description|Cloperidone is a hypotensive sedative}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Cloperidone.svg

| width =

| alt =

| caption =

| image2 =

| width2 =

| alt2 =

| caption2 =

| imageL =

| widthL =

| altL =

| imageR =

| widthR =

| altR =

| captionLR =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 4052-13-5

| CAS_supplemental =

| PubChem = 10675

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 10225

| UNII = 8FP5Y6U39R

| KEGG =

| ChEBI =

| ChEMBL = 2110792

| NIAID_ChemDB =

| PDB_ligand =

| synonyms =

| IUPAC_name = 3-[3-[4-(3-chlorophenyl)piperazin-1-yl]propyl]-1H-quinazoline-2,4-dione

| C=21 | H=23 | Cl=1 | N=4 | O=2

| molecular_weight =

| SMILES = C1CN(CCN1CCCN2C(=O)C3=CC=CC=C3NC2=O)C4=CC(=CC=C4)Cl

| Jmol =

| StdInChI = 1S/C21H23ClN4O2/c22-16-5-3-6-17(15-16)25-13-11-24(12-14-25)9-4-10-26-20(27)18-7-1-2-8-19(18)23-21(26)28/h1-3,5-8,15H,4,9-14H2,(H,23,28)

| StdInChI_comment =

| StdInChIKey = FXZJKVODWNYPKK-UHFFFAOYSA-N

| density =

| density_notes =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| sol_units =

| specific_rotation =

}}

Cloperidone is a quinazolinedione derivative first reported in 1965 by Miles Laboratories, notable for its sedative and antihypertensive properties.{{cite journal | vauthors = Hayao S, Havera HJ, Strycker WG, Leipzig TJ, Kulp RA, Hartzler HE | title = New sedative and hypotensive 3-substituted 2,4(1H,3H)-quinazolinediones | journal = Journal of Medicinal Chemistry | volume = 8 | issue = 6 | pages = 807–815 | date = November 1965 | pmid = 5885076 | doi = 10.1021/jm00330a017 }}{{cite web | title = Cloperidone hydrochloride | url = https://drugs.ncats.io/drug/17682058OP | work = Inxight Drugs | publisher = NCATS | access-date = 8 June 2025 }} Its pharmacological activity has been demonstrated in various animal models, including behavioral studies in dogs and cats, as well as motor coordination and locomotor activity assays in mice. Cloperidone is not an approved drug and appears to remain an experimental compound with no current clinical use.