cloprednol

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (9S,10R,11S,13S,14S,17R)-6-chloro-11,17-dihydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-3-one

| image = Cloprednol.svg

| tradename =

| Drugs.com = {{drugs.com|international|cloprednol}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 5251-34-3

| ATC_prefix = H02

| ATC_suffix = AB14

| PubChem = 10023463

| DrugBank =

| ChEMBL = 1697832

| ChemSpiderID = 4447592

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = SYP56O3GJG

| KEGG = D03561

| C=21 | H=25 | Cl=1 | O=5

| smiles = O=C\1\C=C/[C@]4(C(=C/1)C(\Cl)=C/[C@@H]2[C@@H]4[C@@H](O)C[C@@]3([C@@](O)(C(=O)CO)CC[C@@H]23)C)C

}}

Cloprednol is a synthetic glucocorticoid.{{cite journal |vauthors=Ortega E, Rodriguez C, Strand LJ, Bessler S, Segre E |title=Metabolic effects of cloprednol-a new systemic corticosteroid |journal=J Clin Pharmacol |volume=16 |issue=2–3 |pages=122–8 |year=1976 |pmid=1254734 |doi=10.1002/j.1552-4604.1976.tb02393.x |s2cid=38774591 |url=http://jcp.sagepub.com/cgi/pmidlookup?view=long&pmid=1254734 |url-access=subscription }}{{Dead link|date=July 2019 |bot=InternetArchiveBot |fix-attempted=yes }} It has been investigated for use in asthma.{{cite journal |vauthors=Ellis EF, Morris HG, Kiechel F, Pollock JD, Strand LJ |title=Short-term efficacy and side effects of cloprednol in children with asthma |journal=J Clin Pharmacol |volume=19 |issue=10 |pages=675–83 |date=October 1979 |pmid=512064 |doi=10.1002/j.1552-4604.1979.tb01631.x |s2cid=38757781 |url=http://jcp.sagepub.com/cgi/pmidlookup?view=long&pmid=512064 |url-access=subscription }}{{Dead link|date=July 2019 |bot=InternetArchiveBot |fix-attempted=yes }}