cloxestradiol

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,17S)-13-methyl-17-(2,2,2-trichloro-1-hydroxyethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol

| image = Cloxestradiol.svg

| width = 225px

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| class = Estrogen; Estrogen ether

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 54063-33-1

| CAS_supplemental =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 42R9MZG1DL

| ATC_prefix =

| ATC_suffix =

| PubChem = 194705

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID = 168924

| synonyms = 17-(2,2,2-Trichloroethoxy)estradiol; 17-(1-Hydroxy-2,2,2-trichloroethoxy)estra-1,3,5(10-trien-3-ol

| C=20 | H=25 | Cl=3 | O=3

| SMILES = C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@H]2OC(C(Cl)(Cl)Cl)O)O

| StdInChI = 1S/C20H25Cl3O3/c1-19-9-8-14-13-5-3-12(24)10-11(13)2-4-15(14)16(19)6-7-17(19)26-18(25)20(21,22)23/h3,5,10,14-18,24-25H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18?,19+/m1/s1

| StdInChIKey = JVLHMVXGPLKLFV-AJUWMHLFSA-N

}}

Cloxestradiol ({{abbrlink|INN|International Nonproprietary Name}}), also known as 17-(2,2,2-trichloroethoxy)estradiol, is a synthetic, steroidal estrogen which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA308|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=308–}} It is an analogue of estradiol with a 2,2,2-trichloroethoxy substitution. The O,O-diacetate derivative, cloxestradiol acetate (brand name Genovul), has been marketed as an estrogen.