cloxestradiol
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields =
| Watchedfields =
| verifiedrevid =
| IUPAC_name = (8R,9S,13S,14S,17S)-13-methyl-17-(2,2,2-trichloro-1-hydroxyethoxy)-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol
| image = Cloxestradiol.svg
| width = 225px
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| class = Estrogen; Estrogen ether
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref =
| CAS_number = 54063-33-1
| CAS_supplemental =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 42R9MZG1DL
| ATC_prefix =
| ATC_suffix =
| PubChem = 194705
| DrugBank_Ref =
| DrugBank =
| ChemSpiderID = 168924
| synonyms = 17-(2,2,2-Trichloroethoxy)estradiol; 17-(1-Hydroxy-2,2,2-trichloroethoxy)estra-1,3,5(10-trien-3-ol
| C=20 | H=25 | Cl=3 | O=3
| SMILES = C[C@]12CC[C@@H]3c4ccc(cc4CC[C@H]3[C@@H]1CC[C@@H]2OC(C(Cl)(Cl)Cl)O)O
| StdInChI = 1S/C20H25Cl3O3/c1-19-9-8-14-13-5-3-12(24)10-11(13)2-4-15(14)16(19)6-7-17(19)26-18(25)20(21,22)23/h3,5,10,14-18,24-25H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18?,19+/m1/s1
| StdInChIKey = JVLHMVXGPLKLFV-AJUWMHLFSA-N
}}
Cloxestradiol ({{abbrlink|INN|International Nonproprietary Name}}), also known as 17-(2,2,2-trichloroethoxy)estradiol, is a synthetic, steroidal estrogen which was never marketed.{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA308|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=308–}} It is an analogue of estradiol with a 2,2,2-trichloroethoxy substitution. The O,O-diacetate derivative, cloxestradiol acetate (brand name Genovul), has been marketed as an estrogen.
See also
References
{{Reflist}}
{{Estrogen receptor modulators}}
Category:Trichloromethyl compounds
{{Genito-urinary-drug-stub}}
{{Steroid-stub}}