coelenteramide
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 420873466
| ImageFile = Coelenteramide.svg
| ImageSize = 220px
| PIN = N-[3-Benzyl-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(4-hydroxyphenyl)acetamide
| OtherNames = Coelenteramide
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 50611-86-4
| PubChem = 448487
| SMILES = C1=CC=C(C=C1)CC2=NC(=CN=C2NC(=O)CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 20120243
}}
|Section2={{Chembox Properties
| C=25 | H=21 | N=3 | O=3
| Appearance =
| Density =1.26 g/cm3
| MeltingPt =
| BoilingPtC =
| BoilingPt_notes =
| Solubility =
| Absorbance = ε332.5 = 15000 M−1 cm−1 (methanol){{cite book | last=Shimomura | first=Osamu | title=Bioluminescence : chemical principles and methods | publisher=World Scientific Publishing Co. Pte. Ltd | publication-place=Singapore Hackensack, NJ | year=2012 | isbn=978-981-4366-08-3 | oclc=794263013 }}
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPtC =
| AutoignitionPtC =
}}
}}
Coelenteramide is the oxidized product, or oxyluciferin, of the bioluminescent reactions in many marine organisms that use coelenterazine. It was first isolated as a blue fluorescent protein from Aequorea victoria after the animals were stimulated to emit light.{{cite journal | doi = 10.1073/pnas.72.4.1546 | author = Shimomura O, Johnson FH | title = Chemical Nature of Bioluminescence Systems in Coelenterates | journal = PNAS USA | volume = 72 | pages = 1546–1549 | year = 1975 | pmid = 236561 | issue = 4 | pmc = 432574| doi-access = free }} Under basic conditions, the compound will break down further into coelenteramine and 4-hydroxyphenylacetic acid.
It is an aminopyrazine.Discovery and Validation of a New Family of Antioxidants: The Aminopyrazine Derivatives. M. L. N. Dubuisson, J.-F. Rees and J. Marchand-Brynaert, Mini-Reviews in Medicinal Chemistry, 2004, 4, 159-165, {{doi|10.2174/1389557043403927}}
References
{{Reflist}}
External links
- {{Commonscatinline}}
{{heterocyclic-stub}}