coelenteramide

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 420873466

| ImageFile = Coelenteramide.svg

| ImageSize = 220px

| PIN = N-[3-Benzyl-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(4-hydroxyphenyl)acetamide

| OtherNames = Coelenteramide

|Section1={{Chembox Identifiers

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 50611-86-4

| PubChem = 448487

| SMILES = C1=CC=C(C=C1)CC2=NC(=CN=C2NC(=O)CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 20120243

}}

|Section2={{Chembox Properties

| C=25 | H=21 | N=3 | O=3

| Appearance =

| Density =1.26 g/cm³

| MeltingPt =

| BoilingPtC =

| BoilingPt_notes =

| Solubility =

| Absorbance = ε_332.5 = 15000 M⁻¹ cm⁻¹ (methanol){{cite book | last=Shimomura | first=Osamu | title=Bioluminescence : chemical principles and methods | publisher=World Scientific Publishing Co. Pte. Ltd | publication-place=Singapore Hackensack, NJ | year=2012 | isbn=978-981-4366-08-3 | oclc=794263013 }}

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPtC =

| AutoignitionPtC =

}}

}}

Coelenteramide is the oxidized product, or oxyluciferin, of the bioluminescent reactions in many marine organisms that use coelenterazine. It was first isolated as a blue fluorescent protein from Aequorea victoria after the animals were stimulated to emit light.{{cite journal | doi = 10.1073/pnas.72.4.1546 | author = Shimomura O, Johnson FH | title = Chemical Nature of Bioluminescence Systems in Coelenterates | journal = PNAS USA | volume = 72 | pages = 1546–1549 | year = 1975 | pmid = 236561 | issue = 4 | pmc = 432574| doi-access = free }} Under basic conditions, the compound will break down further into coelenteramine and 4-hydroxyphenylacetic acid.

It is an aminopyrazine.Discovery and Validation of a New Family of Antioxidants: The Aminopyrazine Derivatives. M. L. N. Dubuisson, J.-F. Rees and J. Marchand-Brynaert, Mini-Reviews in Medicinal Chemistry, 2004, 4, 159-165, {{doi|10.2174/1389557043403927}}