coenzyme B
{{chembox
| Verifiedfields = changed
| verifiedrevid = 464184867
| ImageFile=Coenzyme B (CoB).svg
| ImageSize=
| ImageFile2=Coenzyme B 3D BS.png
| ImageSize2=
| IUPACName=2-[(7-mercapto-1-oxoheptyl)amino]-3-phosphonooxybutanoic acid
| OtherNames=
|Section1={{Chembox Identifiers
| InChI = 1/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)/t8-,10-/m1/s1
| InChIKey = JBJSVEVEEGOEBZ-PSASIEDQBT
| InChI1 = 1/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)
| InChIKey1 = JBJSVEVEEGOEBZ-UHFFFAOYAG
| SMILES1 = O=C(NC(C(=O)O)C(OP(=O)(O)O)C)CCCCCCS
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C11H22NO7PS/c1-8(19-20(16,17)18)10(11(14)15)12-9(13)6-4-2-3-5-7-21/h8,10,21H,2-7H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JBJSVEVEEGOEBZ-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo=104302-77-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 9GS022ISQL
| PubChem=350
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 343
| SMILES = O=C(N[C@@H](C(=O)O)[C@H](OP(=O)(O)O)C)CCCCCCS
}}
|Section2={{Chembox Properties
| Formula={{chem|C|11|H|22|NO|7|PS}}
| MolarMass=343.333641
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Coenzyme B is a coenzyme required for redox reactions in methanogens. The full chemical name of coenzyme B is 7-mercaptoheptanoylthreoninephosphate.{{cite journal |vauthors=Noll KM, Rinehart KL, Tanner RS, Wolfe RS |title=Structure of component B (7-mercaptoheptanoylthreonine phosphate) of the methylcoenzyme M methylreductase system of Methanobacterium thermoautotrophicum |journal= Proceedings of the National Academy of Sciences|volume=83 |issue=12 |pages=4238–42 |year=1986 |pmid=3086878 |doi=10.1073/pnas.83.12.4238 |pmc=323707|bibcode=1986PNAS...83.4238N |doi-access=free }} The molecule contains a thiol, which is its principal site of reaction.
Coenzyme B reacts with 2-methylthioethanesulfonate (methyl-Coenzyme M, abbreviated {{chem|CH|3|–S–CoM}}), to release methane in methanogenesis:{{cite journal |author=Thauer RK |title=Biochemistry of methanogenesis: a tribute to Marjory Stephenson. 1998 Marjory Stephenson Prize Lecture |journal=Microbiology |volume=144 |issue=Pt 9 |pages=2377–406 |date=September 1998 |pmid=9782487 |doi=10.1099/00221287-144-9-2377 |doi-access=free }}
:{{chem|link=coenzyme M|CH|3|–S–CoM}} + HS–CoB → {{chem|CH|4}} + CoB–S–S–CoM
This conversion is catalyzed by the enzyme methyl coenzyme M reductase, which contains cofactor F430 as the prosthetic group.
A related conversion that utilizes both HS-CoB and HS-CoM is the reduction of fumarate to succinate, catalyzed by fumarate reductase:{{cite journal |vauthors=Heim S, Künkel A, Thauer RK, Hedderich R |title=Thiol:fumarate reductase (Tfr) from Methanobacterium thermoautotrophicum—identification of the catalytic sites for fumarate reduction and thiol oxidation |journal= European Journal of Biochemistry|volume=253 |issue=1 |pages=292–9 |date=April 1998 |pmid=9578488 |doi=10.1046/j.1432-1327.1998.2530292.x|doi-access=free }}
:HS–CoM + HS–CoB + −{{chem|O|2|CCH{{=}}CHCO|2|-}} → −{{chem|O|2|CCH|2|–CH|2|CO|2|-}} + CoB–S–S–CoM
Importance of coenzyme B in methanogenesis
Coenzyme B is an important component in the terminal step of methane biogenesis.{{cite journal|last1=Dey|first1=Mishtu|last2=Li|first2=Xianghui|last3=Kunz|first3=Ryan C|last4=Ragsdale|first4=Stephen W|date=2010-12-22|title=Detection of Organometallic and Radical Intermediates in the Catalytic Mechanism of Methyl-Coenzyme M Reductase Using the Natural Substrate Methyl-Coenzyme M and a Coenzyme B Substrate Analogue|url=https://pubs-acs-org.hunter.cuny.edu/doi/abs/10.1021/bi101562m|journal=Biochemistry|volume=49|issue=51|pages=10902–10911|doi=10.1021/bi101562m|pmid=21090696}}{{Dead link|date=December 2023 |bot=InternetArchiveBot |fix-attempted=yes }} It acts as a two electron-donor to reduce coenzyme M (methyl-coenzyme) into two molecules a methane and a heterodisulfide.{{cite journal|last1=Cedervall|first1=Peder E|last2=Dey|first2=Mishtu|last3=Pearson|first3=Arwen R|last4=Ragsdale|first4=Stephen W|last5=Wilmot|first5=Carrie M|date=2010-07-22|title=Structural Insight into Methyl-Coenzyme M Reductase Chemistry Using Coenzyme B Analogues|url= |journal= Biochemistry|volume=49|issue=35|pages=7683–7693|doi=10.1021/bi100458d|pmid=20707311|pmc=3098740}} Two separate experiments that were performed, one with coenzyme B and other without coenzyme B, indicated that using coenzyme B before the formation of the methane molecule, results in a more efficient and consistent bond cleavage.{{cite journal|last1=Horng|first1=Yih-Chern|last2=Becker|first2=Donald F|last3=Ragsdale|first3=Stephen W|date=2001-10-30|title=Mechanistic Studies of Methane Biogenesis by Methyl-Coenzyme M Reductase: Evidence that Coenzyme B Participates in Cleaving the C−S Bond of Methyl-Coenzyme M|url=https://pubs-acs-org.hunter.cuny.edu/doi/abs/10.1021/bi011196y|journal=Biochemistry|volume=40|issue=43|pages=12875–12885|doi=10.1021/bi011196y|pmid=11669624}}{{Dead link|date=December 2023 |bot=InternetArchiveBot |fix-attempted=yes }}
References
{{reflist}}
{{Enzyme cofactors}}
{{Enzyme-stub}}