combretastatin B-1

{{Use dmy dates|date=August 2024}}

{{Chembox

| Name = Combretastatin B-1

| ImageFile = Combretastatin B-1.svg

| PIN = 3-Methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol

| OtherNames = Combretastatin B1

|Section1={{Chembox Identifiers

| CASNo_Ref =

| CASNo = 109971-64-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = NK47TS5H6V

| ChEMBL_Ref =

| ChEMBL =

| PubChem = 135716

| SMILES = COC1=C(C(=C(C=C1)CCC2=CC(=C(C(=C2)OC)OC)OC)O)O

| ChemSpiderID = 119539

| SMILES2 = O(c1cc(cc(OC)c1OC)CCc2ccc(OC)c(O)c2O)C

| InChI = 1/C18H22O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h7-10,19-20H,5-6H2,1-4H3

| InChIKey = ZSNYQENLWQYSRK-UHFFFAOYAW

| StdInChI = 1S/C18H22O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h7-10,19-20H,5-6H2,1-4H3

| StdInChIKey = ZSNYQENLWQYSRK-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=18 | H=22 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Combretastatin B-1 is a combretastatin and a dihydrostilbenoid. It can be found in Combretum afrum, the Eastern Cape South African bushwillow tree{{Cite journal | last1 = Pettit | first1 = G. R. | last2 = Singh | first2 = S. B. | last3 = Niven | first3 = M. L. | last4 = Hamel | first4 = E. | last5 = Schmidt | first5 = J. M. | title = Isolation, Structure, and Synthesis of Combretastatins A-1 and B-1, Potent New Inhibitors of Microtubule Assembly, Derived from Combretum caffrum | doi = 10.1021/np50049a016 | journal = Journal of Natural Products | volume = 50 | issue = 1 | pages = 119–131 | year = 1987 | pmid = 3598594}} or in Combretum kraussii, the forest bushwillow.{{cite journal | title = Uteroactive constituents from Combretum kraussii | author = Bridget K Brookes, Olga V Doudoukina, Lynn C Katsoulis and Joy H D Veale | journal = South African Journal of Chemistry | date = 1999 | volume = 52 | issue = 4 | pages = 127 |url=http://connection.ebscohost.com/c/articles/2910831/uteroactive-constituents-from-combretum-kraussii | archive-url=https://web.archive.org/web/20140808063208/http://connection.ebscohost.com/c/articles/2910831/uteroactive-constituents-from-combretum-kraussii | archive-date = 8 August 2014 }}

It can be produced by selective hydrogenation of combretastatin A-1.

It is a potent inhibitor of microtubule assembly in vitro.