coniferin
{{chembox
| ImageFile = Coniferin structure.svg
| ImageSize = 300px
| PIN = (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-
| OtherNames = • β-D-Glucopyranoside 4-(3-hydroxy-1-propenyl)-2-methoxyphenyl
• Coniferyl alcohol β-D-glucoside
|Section1={{Chembox Identifiers
| ChEBI = 16220
| CASNo = 531-29-3
| CASNo_Ref = {{cascite|correct|CAS}}
| ChEMBL = 459056
| ChemSpiderID = 4444067
| EC_number = 803-885-9
| KEGG = C00761
| PubChem = 5280372
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = M6616XLU2J
| InChI = 1/C16H22O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2-5,7,12-21H,6,8H2,1H3/b3-2+/t12-,13-,14+,15-,16-/m1/s1
| InChIKey = SFLMUHDGSQZDOW-FAOXUISGBA
| SMILES = O(c1c(OC)cc(/C=C/CO)cc1)[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)CO
}}
|Section2={{Chembox Properties
| C=16 | H=22 | O=8
| Appearance = White crystalline solid
| Density =
| MeltingPtC = 186
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Coniferin is a glucoside of coniferyl alcohol. This white crystalline solid is a metabolite in conifers, serving as an intermediate in cell wall lignification, as well as having other biological roles. It can also be found in the water root extract of Angelica archangelica subsp. litoralis.{{cite journal | doi = 10.1016/0031-9422(83)83044-1 | title = Dihydrofurocoumarin glucosides from Angelica archangelica and Angelica silvestris | date = 1983 | last1 = Lemmich | first1 = John | last2 = Havelund | first2 = Svend | last3 = Thastrup | first3 = Ole | journal = Phytochemistry | volume = 22 | issue = 2 | pages = 553–555 | bibcode = 1983PChem..22..553L }}
Vanillin was first synthesized from coniferin by chemists Ferdinand Tiemann and Wilhelm Haarmann.{{cite web | url = https://www.acs.org/molecule-of-the-week/archive/v/vanillin.html | title = Vanillin | work = Molecule of the Week | publisher = American Chemical Society | date = September 13, 2016 }}