consalazinic acid

{{Chembox

| ImageFile = Consalazinic acid.svg

| ImageSize = 200px

| ImageAlt =

| IUPACName = 5,13,17-trihydroxy-4,12-bis(hydroxymethyl)-7-methyl-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-9,15-dione

| OtherNames = 1,4,10-Trihydroxy-5,11-bis(hydroxymethyl)-8-methyl-7H-isobenzofuro[4,5-b][1,4]benzodioxepin-3,7(1H)-dione

| Section1 = {{Chembox Identifiers

| CASNo = 77292-23-0

| PubChem = 162888949

| StdInChI=1S/C18H14O10/c1-5-2-8(21)6(3-19)13-9(5)16(23)27-14-7(4-20)12(22)10-11(15(14)26-13)18(25)28-17(10)24/h2,18-22,25H,3-4H2,1H3

| StdInChIKey = VHKZGPSNCSPDGX-UHFFFAOYSA-N

| SMILES = CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3CO)O)C(=O)OC4O)CO)O

}}

| Section2 = {{Chembox Properties

| C = 18 | H = 14 | O = 10

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Consalazinic acid is a chemical compound with the molecular formula {{chem2|C18H14O10}}. It is classified as a depsidone and is a secondary metabolite produced by a variety of lichens.

Consalazinic acid was first isolated from Parmotrema subisidiosum and described in 1980.{{cite journal | doi = 10.1016/S0031-9422(00)91070-7 | title = Structure of the β-orcinol depsidones, connorstictic and consalazinic acids | date = 1980 | last1 = O'Donovan | first1 = Donal G. | last2 = Roberts | first2 = George | last3 = Keogh | first3 = Myles F. | journal = Phytochemistry | volume = 19 | issue = 11 | pages = 2497–2499 | bibcode = 1980PChem..19.2497O }}{{cite journal | doi = 10.2307/3242974 | jstor = 3242974 | title = A Standardized TLC Analysis of β-Orcinol Depsidones | last1 = Culberson | first1 = Chicita F. | last2 = Culberson | first2 = William Louis | last3 = Johnson | first3 = Anita | journal = The Bryologist | date = 1981 | volume = 84 | issue = 1 | pages = 16–29 }} It has since been identified in many other lichens.{{cite journal | title = The Parmelia omphalodes (Ascomycetes) complex in Eastern Fennoscandia. Chemical and morphological variation | author = Skult, Henrik | journal = Annales Botanici Fennici | date = 1984 | volume = 21 | issue = 2 | pages = 117–142 }}{{cite journal | title =

Chemistry of South African lichens | author = Huneck, S.; Kalb, K. | journal = Pharmazie | date = 1990 | volume = 45 | issue = 4 | pages = 297 }}{{cite journal | doi = 10.1016/0021-9673(93)83356-W | title = Identification of lichen substances by a standardized high-performance liquid chromatographic method | date = 1993 | last1 = Feige | first1 = G.B. | last2 = Lumbsch | first2 = H.T. | last3 = Huneck | first3 = S. | last4 = Elix | first4 = J.A. | journal = Journal of Chromatography A | volume = 646 | issue = 2 | pages = 417–427 }}{{cite journal | doi = 10.2307/3244550 | jstor = 3244550 | title = A Contribution to the Chemistry of the Lichen Family Umbilicariaceae (Ascomycotina) | last1 = Narui | first1 = Takao | last2 = Culberson | first2 = Chicita F. | last3 = Culberson | first3 = William Louis | last4 = Johnson | first4 = Anita | last5 = Shibata | first5 = Shoji | journal = The Bryologist | date = 1996 | volume = 99 | issue = 2 | pages = 199–211 }}{{cite journal | doi = 10.1639/0007-2745(2004)107[0152:SCOLFC]2.0.CO;2 | issn = 0007-2745 | date = 2004 | volume = 107 | page = 152 | title = Secondary Chemistry of Lichen-forming Fungi: Chemosyndromic Variation and DNA-analyses of Cultures and Chemotypes in the Ramalina farinacea Complex | last1 = Stocker-Wörgötter | first1 = Elfie | last2 = Elix | first2 = John A. | last3 = Grube | first3 = Martin | journal = The Bryologist | issue = 2 }}{{cite journal | doi = 10.3390/molecules22111861 | doi-access = free | title = Metabolomic Analysis of Two Parmotrema Lichens: P. Robustum (Degel.) Hale and P. Andinum (Mull. Arg.) Hale Using UHPLC-ESI-OT-MS-MS | date = 2017 | last1 = Torres-Benítez | first1 = Alfredo | last2 = Rivera-Montalvo | first2 = María | last3 = Sepúlveda | first3 = Beatriz | last4 = Castro | first4 = Olivio | last5 = Nagles | first5 = Edgar | last6 = Simirgiotis | first6 = Mario | last7 = García-Beltrán | first7 = Olimpo | last8 = Areche | first8 = Carlos | journal = Molecules | volume = 22 | issue = 11 | page = 1861 | pmid = 29084151 | pmc = 6150355 }}{{cite journal | doi = 10.1016/j.jpba.2018.04.017 | title = UPLC–MS/MS quantitative analysis and structural fragmentation study of five Parmotrema lichens from the Eastern Ghats | date = 2018 | last1 = Kumar | first1 = K. | last2 = Siva | first2 = Bandi | last3 = Sarma | first3 = V.U.M. | last4 = Mohabe | first4 = Satish | last5 = Reddy | first5 = A. Madhusudana | last6 = Boustie | first6 = Joel | last7 = Tiwari | first7 = Ashok K. | last8 = Rao | first8 = N. Rama | last9 = Babu | first9 = K. Suresh | journal = Journal of Pharmaceutical and Biomedical Analysis | volume = 156 | pages = 45–57 | pmid = 29689468 | url = https://hal-univ-rennes1.archives-ouvertes.fr/hal-01807884/file/Kumar%20et%20al_UPLC-MS-MS%20Quantitative%20analysis%20and%20structural%20fragmentation%20study%20of%20five.pdf }}

References