copper gluconate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447430210

| IUPAC_name = Copper(II) gluconate

| image = copper gluconate.png

| tradename =

| Drugs.com = {{drugs.com|CONS|copper_gluconate}}

| MedlinePlus = a601072

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration = Oral

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 527-09-3

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = RV823G6G67

| ATC_prefix = V03

| ATC_suffix = AB20

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10242

| chemical_formula =

| C=12 | H=22 | Cu=1 | O=14

| PubChem = 10692

| SMILES = C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Cu+2]

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/2C6H12O7.Cu/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = OCUCCJIRFHNWBP-IYEMJOQQSA-L

| melting_point = 156

| solubility = 30

}}

Copper gluconate is the copper salt of D-gluconic acid. It is an odorless light blue or blue-green crystal or powder which is easily soluble in water and insoluble in ethanol.{{cite web |url=http://www.lyty369.com/Product-38.html |title=产品列表-葡萄糖酸铜 |trans-title=Product list - copper gluconate |publisher=Liaoyang Tengyuan Food Additives Factory |accessdate=March 29, 2013 |archive-url=https://web.archive.org/web/20150402134321/http://www.lyty369.com/Product-38.html |archive-date=April 2, 2015 |url-status=dead }} {{in lang|zh}}{{cite web |url=http://www.chemicalland21.com/lifescience/foco/COPPER%20GLUCONATE.htm |title=Copper Gluconate |publisher=ChemicalLand21 |accessdate=March 29, 2013}}