corbadrine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = verified

| verifiedrevid = 462091113

| IUPAC_name = 4-[(1R,2S)-2-amino-1-hydroxypropyl]benzene-1,2-diol

| image = Corbadrine.svg

| width = 200px

| tradename = Neo-Cobefrine

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 829-74-3

| ATC_prefix = None

| ATC_suffix =

| PubChem = 164739

| IUPHAR_ligand = 508

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB06707

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 144416

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V008L6478D

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D02388

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 677

| synonyms = Levonordefrin; α-Methylnorepinephrine; (–)-3,4-Dihydroxynorephedrine; 3,4,β-Trihydroxy-α-methylphenethylamine; 3,4,β-Trihydroxyamphetamine

| C=9 | H=13 | N=1 | O=3

| SMILES = Oc1ccc(cc1O)[C@@H](O)[C@@H](N)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C9H13NO3/c1-5(10)9(13)6-2-3-7(11)8(12)4-6/h2-5,9,11-13H,10H2,1H3/t5-,9-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GEFQWZLICWMTKF-CDUCUWFYSA-N

}}

Corbadrine, sold under the brand name Neo-Cobefrine and also known as levonordefrin and α-methylnorepinephrine, is a catecholamine sympathomimetic used as a topical nasal decongestant and vasoconstrictor in dentistry in the United States.{{cite book | last=Elks | first=J. | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA55 | access-date=30 August 2024 | page=55}}{{cite book| vauthors = Morton I, Morton IK, Hall JM |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms|url=https://books.google.com/books?id=mqaOMOtk61IC&pg=PA164|date=31 October 1999|publisher=Springer Science & Business Media|isbn=978-0-7514-0499-9|pages=164–}}{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA275|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=275–}} It is usually used in a pre-mixed solution with local anesthetics, such as mepivacaine.{{cite web|title=DailyMed — Search results for levonordefrin|url=http://dailymed.nlm.nih.gov/dailymed/search.cfm?labeltype=all&query=levonordefrin|website=DailyMed|access-date=20 February 2016}}

The drug acts as a non-selective agonist of the α₁-, α₂-, and β-adrenergic receptors.{{cite book | last=Logothetis | first=D.D. | title=Local Anesthesia for the Dental Hygienist | publisher=Elsevier Health Sciences | year=2016 | isbn=978-0-323-43050-0 | url=https://books.google.com/books?id=hUHdCwAAQBAJ&pg=PA46 | access-date=30 August 2024 | page=46}}{{cite book | last=Abraham | first=Donald J. | title=Burger's Medicinal Chemistry and Drug Discovery | publisher=Wiley | date=15 January 2003 | isbn=978-0-471-26694-5 | doi=10.1002/0471266949.bmc093 | page=}}{{cite journal | vauthors = Naftalin LW, Yagiela JA | title = Vasoconstrictors: indications and precautions | journal = Dent Clin North Am | volume = 46 | issue = 4 | pages = 733–746, ix | date = October 2002 | pmid = 12436828 | doi = 10.1016/s0011-8532(02)00021-6 | url = }} It is said to have preferential activity at the α₂-adrenergic receptor.

Corbadrine is also a metabolite of the antihypertensive drug methyldopa and plays a role in its pharmacology and effects.{{cite journal | vauthors = Sjoerdsma A, Vendsalu A, Engelman K | title = Studies on the Metabolism and Mechanism of Action of Methyldopa | journal = Circulation | volume = 28 | issue = 4 | pages = 492–502 | date = October 1963 | pmid = 14068757 | doi = 10.1161/01.CIR.28.4.492 | doi-access = free }}