coutaric acid

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 440124884

| Name = Coutaric acid

| ImageFile = Coutaric acid.svg

| ImageSize = 200px

| ImageName = Chemical structure of coutaric acid

| ImageAlt = Chemical structure of coutaric acid

| PIN = (2R,3R)-2-Hydroxy-3-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy}butanedioic acid

| OtherNames = trans-coutaric acid
cis-coutaric acid
trans-p-Coumaroyltartaric acid
cis-p-coumaroyl-(+)-tartaric acid
trans-p-coumaroyl-(+)-tartaric acid
cis-Coumaroyl tartaric acidbr>trans-Coumaroyl tartaric acid

|Section1={{Chembox Identifiers

| CASNo = 27174-07-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K874CF6AHR

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNoOther =

| PubChem = 57517924

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 26325199

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 77439

| SMILES = c1cc(ccc1/C=C/C(=O)O[C@H]([C@H](C(=O)O)O)C(=O)O)O

| InChI = 1/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1

| InChIKey = INYJZRKTYXTZHP-NNPIPJJVBX

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C13H12O8/c14-8-4-1-7(2-5-8)3-6-9(15)21-11(13(19)20)10(16)12(17)18/h1-6,10-11,14,16H,(H,17,18)(H,19,20)/b6-3+/t10-,11-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = INYJZRKTYXTZHP-NNPIPJJVSA-N

| MeSHName =

}}

|Section2={{Chembox Properties

| C=13 | H=12 | O=8

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Coutaric acid is a hydroxycinnamoyltartaric acid found in wine, pomace{{Cite journal | last1 = Maier | first1 = T. | last2 = Sanzenbacher | first2 = S. | last3 = Kammerer | first3 = D. R. | last4 = Berardini | first4 = N. | last5 = Conrad | first5 = J. R. | last6 = Beifuss | first6 = U. | last7 = Carle | first7 = R. | last8 = Schieber | first8 = A. | doi = 10.1016/j.chroma.2006.06.082 | title = Isolation of hydroxycinnamoyltartaric acids from grape pomace by high-speed counter-current chromatography | journal = Journal of Chromatography A | volume = 1128 | issue = 1–2 | pages = 61–67 | year = 2006 | pmid = 16860334}} and grape.{{Cite journal | last1 = Singleton | first1 = V. L. | last2 = Zaya | first2 = J. | last3 = Trousdale | first3 = E. K. | doi = 10.1016/0031-9422(86)80078-4 | title = Caftaric and coutaric acids in fruit of Vitis | journal = Phytochemistry | volume = 25 | issue = 9 | pages = 2127 | year = 1986 }} It is an ester formed from coumaric acid and tartaric acid.