cupferron

{{chembox

| Watchedfields = changed

| verifiedrevid = 420653113

| Name = Cupferron

| ImageFile = cupferron.svg

| ImageName = Cupferron

| OtherNames = cupferron
ammonium N-nitrosophenylhydroxylamine

|Section1={{Chembox Identifiers

| SMILES = O=NN([O-])c1ccccc1.[NH4+]

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2006262

| PubChem = 2724103

| EC_number = 205-183-2

| InChI = 1/C6H5N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5H;1H3/q-1;/p+1

| InChIKey = GDEBSAWXIHEMNF-IKLDFBCSAP

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C6H5N2O2.H3N/c9-7-8(10)6-4-2-1-3-5-6;/h1-5H;1H3/q-1;/p+1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = GDEBSAWXIHEMNF-UHFFFAOYSA-O

| CASNo_Ref = {{cascite|correct|??}}

| CASNo = 135-20-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V66QK963ED

}}

|Section2={{Chembox Properties

| C=6 | H=9 | N=3 | O=2

| Solubility = Soluble

| MeltingPtC = 150 to 155

}}

|Section7={{Chembox Hazards

| GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}

| GHSSignalWord = Danger

| HPhrases = {{H-phrases|301|315|319|335|351 }}

| PPhrases = {{P-phrases|201|202|261|264|270|271|280|281|301+310|302+352|304+340|305+351+338|308+313|312|321|330|332+313|337+313|362|403+233|405|501}}

}}

}}

Cupferron is jargon for the ammonium salt of the conjugate base derived from N-nitroso-N-phenylhydroxylamine. This conjugate base is abbreviated as CU⁻. It once was a common reagent for the complexation of metal ions, being of interest in the area of qualitative inorganic analysis. Its formula is NH₄[C₆H₅N(O)NO]. The anion binds to metal cations through the two oxygen atoms, forming five-membered chelate rings.