cyclohexylthiophthalimide

{{chembox

| Name=cyclohexylthiophthalimide

| verifiedrevid = 444020789

| Reference =

| ImageFile =Cyclohexylthiophthalimid.svg

| ImageSize =200px

| PIN = 2-(Cyclohexylsulfanyl)-1H-isoindole-1,3(2H)-dione

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations = CTP

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 17796-82-6

| EINECS = 2417741

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 50Z9596NJ3

| PubChem = 28777

| ChemSpiderID = 26768

| SMILES = O=C3c1ccccc1C(=O)N3SC2CCCCC2

| InChI = 1/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2

| InChIKey = UEZWYKZHXASYJN-UHFFFAOYAT

| StdInChI = 1S/C14H15NO2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10/h4-5,8-10H,1-3,6-7H2

| StdInChIKey = UEZWYKZHXASYJN-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=14|H=15|N=1|O=2|S=1

| Appearance = Colourless solid

| MeltingPtC = 90

}}

|Section7={{Chembox Hazards

}}

|Section8={{Chembox Related

| OtherFunction_label =

| OtherFunction =

}}

}}

Cyclohexylthiophthalimide (abbreviated CTP) is an organosulfur compound that is used in production of rubber. It is a white solid, although commercial samples often appear yellow. It features the sulfenamide functional group, being a derivative of phthalimide and cyclohexanethiol.Hans-Wilhelm Engels, Herrmann-Josef Weidenhaupt, Manfred Pieroth, Werner Hofmann, Karl-Hans Menting, Thomas Mergenhagen, Ralf Schmoll, Stefan Uhrlandt “Rubber, 4. Chemicals and Additives” in Ullmann's Encyclopedia of Industrial Chemistry, 2004, Wiley-VCH, Weinheim. {{doi|10.1002/14356007.a23_365.pub2}} In the production of synthetic rubber, CTP impedes the onset of sulfur vulcanization.