cyheptamide

{{Short description|Anticonvulsant compound made from dibenzosuberone}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Infobox drug

| drug_name = Cyheptamide

| image = Cyheptamide.svg

| width =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| licence_CA =

| licence_EU =

| DailyMedID =

| licence_US =

| pregnancy_AU =

| pregnancy_category =

| dependency_liability =

| addiction_liability =

| routes_of_administration =

| class =

| ATC_prefix =

| ATC_suffix =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| CAS_number = 7199-29-3

| CAS_supplemental =

| PubChem = 23603

| IUPHAR_ligand =

| DrugBank =

| ChemSpiderID = 22071

| UNII = 6R22P8K61P

| KEGG = D03628

| ChEBI =

| ChEMBL = 1868301

| NIAID_ChemDB =

| PDB_ligand =

| synonyms = Cyheptamine

| IUPAC_name = tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaene-2-carboxamide

| C = 16

| H = 15

| N = 1

| O = 1

| SMILES = C1CC2=CC=CC=C2C(C3=CC=CC=C31)C(=O)N

| StdInChI = 1S/C16H15NO/c17-16(18)15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H2,17,18)

| StdInChIKey = APBVLLORZMAWKI-UHFFFAOYSA-N

}}

Cyheptamide was a investigational new drug that was developed by Ayerst Research Laboratories in the 1960s and was evaluated as an anticonvulsant.{{cite web |url=https://drugs.ncats.io/drug/6R22P8K61P |title= Cyheptamide |website=Inxight: Drugs |publisher=NCATS |access-date=2025-06-25}}

Cyheptamide undergoes significant metabolic transformation in both animals and humans, primarily through hydroxylation pathways.{{cite journal | vauthors = Kraml M, Sestanj K, Dvornik D | title = Metabolism of the anticonvulsant 10,11-dihydro-5H-dibenzo(a,d)cycloheptene-5-carboxamide. I. Metabolic fate of (14C)cyheptamide in animals and man | journal = Biochemical Pharmacology | volume = 20 | issue = 9 | pages = 2327–2338 | date = September 1971 | pmid = 5163146 | doi = 10.1016/0006-2952(71)90232-2 }}

Cyheptamide exhibits moderate acute toxicity in animal models, with species-specific variations in lethal dose values.{{cite journal | vauthors = van Eeken CJ, Birtwhistle RD, Mulder D | title = Toxicological study of cyheptamide: 10,11-dihydro-5H-dibenzo[a,d]cycloheptene-5-carboxamide (BS 7029) | journal = Archives Internationales de Pharmacodynamie et de Therapie | volume = 188 | issue = 1 | pages = 79–85 | date = November 1970 | pmid = 5485105 }}