dansyl amide
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 428770948
| ImageFile=Dansyl amide.svg
| ImageSize=150px
| ImageFile1 = Dansyl amide molecule ball.png
| ImageSize1 = 150
| ImageAlt1 = Ball-and-stick model of the dansyl amide molecule
| PIN=5-(Dimethylamino)naphthalene-1-sulfonamide
| OtherNames=Dansyl amide
|Section1={{Chembox Identifiers
| CASNo = 1431-39-6
| CASNo_Ref = {{cascite|correct|CAS}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZUZ5S5875E
| PubChem = 65077
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 58587
| SMILES = O=S(=O)(c1cccc2c1cccc2N(C)C)N
| InChI = 1/C12H14N2O2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3,(H2,13,15,16)
| InChIKey = TYNBFJJKZPTRKS-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C12H14N2O2S/c1-14(2)11-7-3-6-10-9(11)5-4-8-12(10)17(13,15)16/h3-8H,1-2H3,(H2,13,15,16)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = TYNBFJJKZPTRKS-UHFFFAOYSA-N
}}
|Section2={{Chembox Properties
| Formula=C12H14N2O2S
| MolarMass=250.31676
| Appearance=
| Density=
| MeltingPt=
| BoilingPt=
| Solubility=
}}
|Section3={{Chembox Hazards
| MainHazards=
| FlashPt=
| AutoignitionPt =
}}
}}
Dansyl amide is a fluorescent dye that forms in a reaction between dansyl chloride and ammonia. It is the simplest representative of the class of dansyl derivatized amines, which are widely used in biochemistry and chemistry as fluorescent labels.{{cite journal |vauthors=Misra A, Tripathi S, Misra K |title=Fluorescent labelling of ribonucleosides at 2'-terminus; comparative fluorescence studies |journal=Nucleic Acids Symp. Ser. |volume= 44|issue=44 |pages=291–2 |year=2000 |doi=10.1093/nass/44.1.291 |pmid=12903383|doi-access= }} The dansyl amide moiety is also called a dansyl group, and it can be introduced into amino acids or other amines in a reaction with dansyl chloride.{{cite journal |doi=10.1016/0003-2697(81)90534-0 |vauthors=Tapuhi Y, Schmidt DE, Lindner W, Karger BL |title=Dansylation of amino acids for high-performance liquid chromatography analysis |journal=Anal. Biochem. |volume=115 |issue=1 |pages=123–9 |date=July 1981 |pmid=7304940}} The dansyl group is highly fluorescent, and it has a very high Stokes shift. The excitation maximum (ca 350 nm) is essentially independent on the medium, whereas the emission maximum strongly depends on the solvent and varies from 520 to 550 nm.Makoto Asano, Frangoise M.Winnik, Takashi Yamashita, and Kazuyuki Horief. Fluorescence Studies of Dansyl-Labeled Poly(iV-isopropylacrylamide)Gels and Polymers in Mixed Water/Methanol Solutions. Macromolecules, 1995, 28, 5861—5866.