danuglipron

{{Short description|Chemical compound}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = Danuglipron.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category =

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status = Investigational

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action =

| excretion =

| synonyms = PF-06882961

| CAS_number = 2230198-02-2

| ChEMBL = 4518483

| ChEBI = 231951

| PubChem = 134611040

| UNII = DN9IUI24GP

| DrugBank =

| IUPAC_name = 2-[[4-[6-[(4-Cyano-2-fluorophenyl)methoxy]pyridin-2-yl]piperidin-1-yl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylic acid

| C = 31

| H = 30

| F = 1

| N = 5

| O = 4

| StdInChI = 1S/C31H30FN5O4/c32-25-14-20(16-33)4-5-23(25)19-41-30-3-1-2-26(35-30)21-8-11-36(12-9-21)18-29-34-27-7-6-22(31(38)39)15-28(27)37(29)17-24-10-13-40-24/h1-7,14-15,21,24H,8-13,17-19H2,(H,38,39)/t24-/m0/s1

| StdInChIKey = HYBAKUMPISVZQP-DEOSSOPVSA-N

| smiles = C1CO[C@@H]1CN2C3=C(C=CC(=C3)C(=O)O)N=C2CN4CCC(CC4)C5=NC(=CC=C5)OCC6=C(C=C(C=C6)C#N)F

}}

Danuglipron is a small-molecule GLP-1 agonist, formerly under development by Pfizer{{cite journal | vauthors = Griffith DA, Edmonds DJ, Fortin JP, Kalgutkar AS, Kuzmiski JB, Loria PM, Saxena AR, Bagley SW, Buckeridge C, Curto JM, Derksen DR, Dias JM, Griffor MC, Han S, Jackson VM, Landis MS, Lettiere D, Limberakis C, Liu Y, Mathiowetz AM, Patel JC, Piotrowski DW, Price DA, Ruggeri RB, Tess DA | display-authors = 6 | title = A Small-Molecule Oral Agonist of the Human Glucagon-like Peptide-1 Receptor | journal = Journal of Medicinal Chemistry | volume = 65 | issue = 12 | pages = 8208–8226 | date = June 2022 | pmid = 35647711 | pmc = 9234956 | doi = 10.1021/acs.jmedchem.1c01856 }} that, in an oral formulation, was under investigation as a therapy for diabetes mellitus. Initial results from a randomized controlled trial indicated that it reduced weight[https://angeliclifttrio.com/ozempic-weight-loss-prescription-near-me-in-miami-fl-wegovy-semaglutide-injections/ Medical Weight Loss] and improved diabetic control. The most commonly reported adverse events were nausea, diarrhea, and vomiting.{{cite journal | vauthors = Saxena AR, Frias JP, Brown LS, Gorman DN, Vasas S, Tsamandouras N, Birnbaum MJ | title = Efficacy and Safety of Oral Small Molecule Glucagon-Like Peptide 1 Receptor Agonist Danuglipron for Glycemic Control Among Patients With Type 2 Diabetes: A Randomized Clinical Trial | journal = JAMA Network Open | volume = 6 | issue = 5 | pages = e2314493 | date = May 2023 | pmid = 37213102 | pmc = 10203889 | doi = 10.1001/jamanetworkopen.2023.14493 }}{{Cite web |last=Constantino |first=Annika Kim |date=2023-12-02 |title=Pfizer's twice-daily weight loss pill joins a long list of obesity drug flops |url=https://www.cnbc.com/2023/12/02/pfizer-weight-loss-pill-joins-list-of-obesity-drug-flops.html |access-date=2023-12-03 |website=CNBC |language=en}} However, in April 2025, Pfizer announced it would abandon further development of Danuglipron due to unpredictable liver toxicity.{{cite web |last=Kim Constantino |first=Annika |date=April 14, 2025 |title=Pfizer scraps daily weight loss pill after liver injury in one patient |url=https://www.cnbc.com/2025/04/14/pfizer-scraps-daily-weight-loss-pill-danuglipron.html |website=CNBC}}