dapiprazole
{{Short description|Chemical compound}}
{{distinguish|aripiprazole|brexpiprazole}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460112976
| IUPAC_name = 3-{2-[4-(2-methylphenyl)piperazin-1-yl]ethyl}-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,5-a]pyridine
| image = Dapiprazole.svg
| tradename =
| Drugs.com = {{drugs.com|CDI|dapiprazole}}
| MedlinePlus = a601043
| pregnancy_category = B
| legal_status = Rx-only
| routes_of_administration = Topical (eye drops)
| bioavailability = Negligible when administered topically
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 7155
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 72822-12-9
| ATC_prefix = S01
| ATC_suffix = EX02
| PubChem = 3033538
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00298
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2298190
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5RNZ8GJO7K
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07775
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 51066
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201216
| C=19 | H=27 | N=5
| smiles = n1nc(n2c1CCCC2)CCN4CCN(c3ccccc3C)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H27N5/c1-16-6-2-3-7-17(16)23-14-12-22(13-15-23)11-9-19-21-20-18-8-4-5-10-24(18)19/h2-3,6-7H,4-5,8-15H2,1H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = RFWZESUMWJKKRN-UHFFFAOYSA-N
}}
Dapiprazole (brand name Rev-Eyes) is an alpha-1 blocker. It is used to reverse mydriasis after eye examination.{{cite journal | vauthors = Doughty MJ, Lyle WM | s2cid = 22781280 | title = A review of the clinical pharmacokinetics of pilocarpine, moxisylyte (thymoxamine), and dapiprazole in the reversal of diagnostic pupillary dilation | journal = Optometry and Vision Science | volume = 69 | issue = 5 | pages = 358–68 | date = May 1992 | pmid = 1350669 | doi = 10.1097/00006324-199205000-00005 }}
References
{{Reflist}}
{{Antiglaucoma preparations and miotics}}
{{Adrenergic receptor modulators}}
{{Piperazines}}
{{Antihypertensive-stub}}