dasolampanel

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = (3S,4aS,6S,8aR)-6-(3-Chloro-2-(1H-tetrazol-5-yl)phenoxy)decahydroisoquinoline-3-carboxylic acid

| image = Dasolampanel.svg

| CAS_number = 503294-13-1

| ATC_prefix = None

| ATC_suffix =

| PubChem = 51049972

| DrugBank =

| ChemSpiderID = 25948207

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 1P85D6BE9K

| KEGG = D10107

| C=17 | H=20 | Cl=1 | N=5 | O=3

| smiles = c1cc(c(c(c1)Cl)c2[nH]nnn2)O[C@H]3CC[C@H]4CN[C@@H](C[C@H]4C3)C(=O)O

| StdInChI = 1S/C17H20ClN5O3/c18-12-2-1-3-14(15(12)16-20-22-23-21-16)26-11-5-4-9-8-19-13(17(24)25)7-10(9)6-11/h1-3,9-11,13,19H,4-8H2,(H,24,25)(H,20,21,22,23)/t9-,10+,11-,13-/m0/s1

| StdInChIKey = LAKQPSQCICNZII-NOHGZBONSA-N

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

}}

Dasolampanel (INN, USAN, code name NGX-426) is an orally bioavailable analog of tezampanel and thereby competitive antagonist of the AMPA and kainate receptors which was under development by Raptor Pharmaceuticals/Torrey Pines Therapeutics for the treatment of chronic pain conditions including neuropathic pain and migraine.{{cite book | vauthors = Stolerman IP |title=Encyclopedia of Psychopharmacology|url=https://books.google.com/books?id=qoyYobgX0uwC&pg=PA514|date=31 July 2010|publisher=Springer Science & Business Media|isbn=978-3-540-68698-9|pages=514–}} It was developed as a follow-on compound to tezampanel, as tezampanel is not bioavailable orally and must be administered by intravenous injection,{{cite book| vauthors = Olesen J, Ramadan N |title=Innovative Drug Development for Headache Disorders|url=https://books.google.com/books?id=h72Zdp1gtXYC&pg=PA188|date=21 August 2008|publisher=Oxford University Press|isbn=978-0-19-955276-4|pages=188–}}{{cite book| vauthors = Firestein GS, Budd R, Gabriel SE, O'Dell JR, McInnes IB |title=Kelley's Textbook of Rheumatology: Expert Consult Premium Edition: Enhanced Online Features|url=https://books.google.com/books?id=R4ATV-17cv8C&pg=PA1031|date=31 August 2012|publisher=Elsevier Health Sciences|isbn=978-1-4557-3767-3|pages=1031–}} but ultimately neither drug was ever marketed.