daucosterol

{{Chembox

| ImageFile = Eleutheroside A.svg

| ImageSize = 200px

| ImageAlt =

| PIN = (2R,3R,4S,5S,6R)-2-({(1R,3aS,3bS,7S,9aR,9bS,11aR)-1-[(2R,5R)-5-Ethyl-6-methylheptan-2-yl]-9a,11a-dimethyl-2,3,3a,3b,4,6,7,8,9,9a,9b,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-7-yl}oxy)-6-(hydroxymethyl)oxane-3,4,5-triol

| OtherNames = Lyoniside, Daucosterol, Sitogluside, Eleutheroside A, Alexandrin, Coriandrinol, Daucosterin, β-Sitosterol glucoside

|Section1={{Chembox Identifiers

| CASNo = 474-58-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = U45VN859W3

| CASNo_Ref = {{cascite|correct|CAS}}

| PubChem = 5742590

| ChEBI = 67554

| SMILES = CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C(C)C

| ChemSpiderID = 4674825

| StdInChI = 1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1

| StdInChIKey = NPJICTMALKLTFW-OFUAXYCQSA-N}}

|Section2={{Chembox Properties

| C=35 | H=60 | O=6

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Daucosterol (eleutheroside A) is a natural phytosterol-like compound.{{cite journal |last1=Xie |first1=Jingxi |last2=Ji |first2=Zheng |date=1981 |title=Zhōngyào yādǎnzǐ huàxué chéngfèn de yánjiū: I. Yādǎnzǐ jiǎ, yǐ hé bǐng sù de fēnlí yǔ jiàndìng |trans-title=The chemical constituents of the Chinese drug "Yadanzi" I. Isolation and identification of daucosterol, brucein D and brucein E |url=http://www.yxxb.com.cn:8081/aps/CN/abstract/abstract13166.shtml |journal=Yàoxué Xuébào |trans-journal=Acta Pharmaceutica Sinica |lang=zh |volume=16 |issue=1 |pages=53–55 |pmid=7246155 |s2cid=43437861}} It is the glucoside of β-sitosterol.

References