decoquinate

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 405798585

| IUPAC_name = 6-Decoxy-7-ethoxy-4-oxo-1H-quinoline-3-carboxylic acid ethyl ester

| image = decoquinate.png

| width = 250

| tradename =

| Drugs.com = {{drugs.com|international|decoquinate}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 18507-89-6

| ATCvet = yes

| ATC_prefix = P51

| ATC_suffix = BX04

| PubChem = 29112

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 534I52PVWH

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D03667

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 416230

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 27081

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C24H35NO5/c1-4-7-8-9-10-11-12-13-14-30-21-15-18-20(16-22(21)28-5-2)25-17-19(23(18)26)24(27)29-6-3/h15-17H,4-14H2,1-3H3,(H,25,26)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JHAYEQICABJSTP-UHFFFAOYSA-N

| chemical_formula =

| C=24 | H=35 | N=1 | O=5

| smiles = CCCCCCCCCCOC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)OCC)OCC

}}

Decoquinate is a quinolone coccidiostat used in veterinary medicine.{{cite book | chapter = Antiparasitic drugs | first = Stephen W | last = Page | name-list-style = vanc | title = Small Animal Clinical Pharmacology | edition = Second | date = 2008}}

References

{{reflist}}

Further reading

  • {{cite journal | vauthors = da Cruz FP, Martin C, Buchholz K, Lafuente-Monasterio MJ, Rodrigues T, Sönnichsen B, Moreira R, Gamo FJ, Marti M, Mota MM, Hannus M, Prudêncio M | display-authors = 6 | title = Drug screen targeted at Plasmodium liver stages identifies a potent multistage antimalarial drug | journal = The Journal of Infectious Diseases | volume = 205 | issue = 8 | pages = 1278–86 | date = April 2012 | pmid = 22396598 | pmc = 3308910 | doi = 10.1093/infdis/jis184 }}

Category:Antiparasitic agents

Category:4-Quinolones

Category:Catechol ethers

Category:Carboxylate esters

Category:Ethyl esters

Category:Ethoxy compounds

{{antiinfective-drug-stub}}