decoquinate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 405798585
| IUPAC_name = 6-Decoxy-7-ethoxy-4-oxo-1H-quinoline-3-carboxylic acid ethyl ester
| image = decoquinate.png
| width = 250
| tradename =
| Drugs.com = {{drugs.com|international|decoquinate}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 18507-89-6
| ATCvet = yes
| ATC_prefix = P51
| ATC_suffix = BX04
| PubChem = 29112
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = 534I52PVWH
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D03667
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 416230
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 27081
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C24H35NO5/c1-4-7-8-9-10-11-12-13-14-30-21-15-18-20(16-22(21)28-5-2)25-17-19(23(18)26)24(27)29-6-3/h15-17H,4-14H2,1-3H3,(H,25,26)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = JHAYEQICABJSTP-UHFFFAOYSA-N
| chemical_formula =
| C=24 | H=35 | N=1 | O=5
| smiles = CCCCCCCCCCOC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)OCC)OCC
}}
Decoquinate is a quinolone coccidiostat used in veterinary medicine.{{cite book | chapter = Antiparasitic drugs | first = Stephen W | last = Page | name-list-style = vanc | title = Small Animal Clinical Pharmacology | edition = Second | date = 2008}}
References
{{reflist}}
Further reading
- {{cite journal | vauthors = da Cruz FP, Martin C, Buchholz K, Lafuente-Monasterio MJ, Rodrigues T, Sönnichsen B, Moreira R, Gamo FJ, Marti M, Mota MM, Hannus M, Prudêncio M | display-authors = 6 | title = Drug screen targeted at Plasmodium liver stages identifies a potent multistage antimalarial drug | journal = The Journal of Infectious Diseases | volume = 205 | issue = 8 | pages = 1278–86 | date = April 2012 | pmid = 22396598 | pmc = 3308910 | doi = 10.1093/infdis/jis184 }}
{{antiinfective-drug-stub}}