dectaflur
{{short description|Fluoride-containing substance}}
{{drugbox
| IUPAC_name = 9-Octadeceylamine hydrofluoride
| image = Dectaflur Structural Formula V.1.svg
| width = 300
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 7333-84-8
| ATC_prefix = none
| ATC_suffix =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q3B1Y93C1S
| DrugBank =
| C=18|H=38|F=1|N=1
| PubChem = 6433498
| ChemSpiderID = 4938643
| ChEMBL = 2106567
| smiles = [F-].C(=C/CCCCCCCC)\CCCCCCCC[NH3+]
| StdInChI = 1S/C18H37N.FH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;/h9-10H,2-8,11-19H2,1H3;1H/b10-9+;
| StdInChIKey = QGSCPWWHMSCFOV-RRABGKBLSA-N
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category=
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status = OTC
| routes_of_administration = Topical (gel, solution)
}}
Dectaflur (INN) is a fluoride-containing substance used for the prevention and treatment of dental caries, sensitive teeth, and the refluoridation of damaged tooth enamel, typically in combination with olaflur.{{cite book|title=Austria-Codex|at=Elmex Zahngel| veditors = Haberfeld H |publisher=Österreichischer Apothekerverlag|location=Vienna|year=2009|edition=2009/2010|isbn=978-3-85200-196-8|language=de}}
Chemistry and mechanism of action
Dectaflur consists of oleyl amine (the amine corresponding to oleyl alcohol) and hydrofluoric acid. Oleyl amine with its long lipophilic hydrocarbon chain has surfactant properties. It forms a film layer on the surface of teeth, which facilitates incorporation of fluoride into the top layers of the enamel, reaching a depth of only a few nanometers. The precise mechanism of action is unknown.{{cite journal | vauthors = Müller F, Zeitz C, Mantz H, Ehses KH, Soldera F, Schmauch J, Hannig M, Hüfner S, Jacobs K | display-authors = 6 | title = Elemental depth profiling of fluoridated hydroxyapatite: saving your dentition by the skin of your teeth? | journal = Langmuir | volume = 26 | issue = 24 | pages = 18750–9 | date = December 2010 | pmid = 21090577 | doi = 10.1021/la102325e }}
Side effects
Like other fluorides, dectaflur is toxic when overdosed over an extended period of time. Especially in children, before the development of the permanent teeth, overdosage can lead to dental fluorosis.{{cite journal | vauthors = Abanto Alvarez J, Rezende KM, Marocho SM, Alves FB, Celiberti P, Ciamponi AL | title = Dental fluorosis: exposure, prevention and management | journal = Medicina Oral, Patologia Oral y Cirugia Bucal | volume = 14 | issue = 2 | pages = E103-7 | date = February 2009 | pmid = 19179949 }}
References
{{reflist}}
{{Stomatological preparations}}