delequamine
{{Short description|Abandoned α2-adrenoceptor antagonist}}
{{cs1 config|name-list-style=vanc|display-authors=6}}
{{Infobox drug
| drug_name =
| image = Delequamine.svg
| width =
| caption =
| pronounce =
| tradename =
| Drugs.com =
| MedlinePlus =
| licence_CA =
| licence_EU =
| DailyMedID =
| licence_US =
| pregnancy_AU =
| pregnancy_category =
| dependency_liability =
| addiction_liability =
| routes_of_administration =
| class = α2-Adrenergic receptor antagonist
| ATC_prefix =
| ATC_suffix =
| legal_status =
| bioavailability =
| protein_bound =
| metabolism =
| metabolites =
| onset =
| elimination_half-life =
| duration_of_action =
| excretion =
| CAS_number = 119813-87-5
| CAS_supplemental =
119905-05-4
| PubChem = 60713
| PubChemSubstance =
| IUPHAR_ligand =
| DrugBank =
| ChemSpiderID = 54718
| UNII = L37HF85G8S
| KEGG =
| ChEBI =
| ChEMBL = 163911
| NIAID_ChemDB =
| PDB_ligand =
| synonyms = DMMIN; RS-15385; RS 15385; RS15385; RS 15385-197; RS-15385-197; RS15385-197
| IUPAC_name = (8aR,12aS,13aS)-3-methoxy-12-methylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine
| C=18 | H=26 | N=2 | O=3 | S=1
| SMILES = COC1=CC2=C(C=C1)[C@@H]3C[C@H]4[C@H](CCCN4S(=O)(=O)C)CN3CC2
| StdInChI = 1S/C18H26N2O3S/c1-23-15-5-6-16-13(10-15)7-9-19-12-14-4-3-8-20(24(2,21)22)17(14)11-18(16)19/h5-6,10,14,17-18H,3-4,7-9,11-12H2,1-2H3/t14-,17+,18+/m1/s1
| StdInChIKey = JKDBLHWERQWYKF-JLSDUUJJSA-N
}}
Delequamine ({{Abbrlink|INN|International Nonproprietary Name}}; developmental code names RS-15385, RS-15385-197) is a potent and selective α2-adrenergic receptor antagonist which was under development for the treatment of erectile dysfunction and major depressive disorder but was never marketed.{{cite web | title=Delequamine | work = AdisInsight | publisher = Springer Nature Switzerland AG | date=22 September 1999 | url=https://adisinsight.springer.com/drugs/800004435 | access-date=21 October 2024}}{{cite book | vauthors = Ganellin CR, Triggle DJ | title=Dictionary of Pharmacological Agents | publisher=Taylor & Francis | year=1996 | isbn=978-0-412-46630-4 | url=https://books.google.com/books?id=Z_mfTTIApVEC | access-date=21 October 2024 | page=}}{{cite journal | vauthors = Bancroft J | title = Effects of alpha-2 blockade on sexual response: experimental studies with Delequamine (RS15385) | journal = International Journal of Impotence Research | volume = 12 | issue = S1 | pages = S64-S69 | date = March 2000 | pmid = 10849567 | doi = 10.1038/sj.ijir.3900507 }}
It is structurally related to the naturally occurring α2-adrenergic receptor antagonist yohimbine but has greater selectivity in comparison.{{cite book | vauthors = Maw GN | chapter = Pharmacological Therapy for the Treatment of Erectile Dysfunction | veditors = Greenlee W, Hagmann WK, Plattner JJ, Robertson D, Trainor GL, Wong WW, Doherty AM | title=Annual Reports in Medicinal Chemistry | publisher=Academic Press | series=Annual Reports in Medicinal Chemistry | volume = 34 | year=1999 | isbn=978-0-08-058378-5 | chapter-url=https://books.google.com/books?id=pJ1TIGO9VVYC&pg=PA78 | access-date=21 October 2024 | page=78}} The drug has been found to affect sexual function and sleep in humans.
Delequamine reached phase 3 clinical trials prior to the discontinuation of its development. The drug was under development in the 1990s and its development was discontinued by 1999. It was first described in the scientific literature by 1990.{{cite journal | vauthors = Clark RD, Spedding M, MacFarlane CB | title = RS-15385-197, a potent andselective alpha2-adrenoceptor antagonist. | journal = British Journal of Pharmacology | date = 1990 | volume = 99 | page = 123P | url = https://scholar.google.com/scholar?cluster=6701996947549813409 }}