denopamine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 4-[(1S)-2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-hydroxyethyl]phenol

| image = Denopamine.svg

| width = 275

| tradename =

| Drugs.com = {{drugs.com|international|denopamine}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only (JP)

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 71771-90-9

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 71754

| ChEMBL = 493682

| IUPHAR_ligand = 534

| DrugBank =

| ChemSpiderID = 64795

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = V5F60UPD8P

| KEGG = D02614

| chemical_formula =

| C = 18

| H = 23

| N = 1

| O = 4

| smiles = O(c1ccc(cc1OC)CCNC[C@@H](O)c2ccc(O)cc2)C

}}

Denopamine (INN) is a drug which acts as a β₁ adrenergic receptor agonist.{{cite journal | vauthors = Ishide T | title = Denopamine, a selective beta1-receptor agonist and a new coronary vasodilator | journal = Current Medical Research and Opinion | volume = 18 | issue = 7 | pages = 407–13 | year = 2002 | pmid = 12487507 | doi = 10.1185/030079902125001119 | s2cid = 25048757 }} It is used in the treatment of angina{{cite journal | vauthors = Nakajima D, Negoro N, Nakaboh A, Nakakoji T, Hoshiga M, Nariyama J, Ishihara T, Hanafusa T | display-authors = 6 | title = Effectiveness of low dose denopamine, a beta1-adrenoceptor agonist, in a patient with vasospastic angina refractory to intensive medical treatment | journal = International Journal of Cardiology | volume = 108 | issue = 2 | pages = 281–3 | date = April 2006 | pmid = 15913812 | doi = 10.1016/j.ijcard.2005.03.012 }} and may also have potential uses in the treatment of congestive heart failure{{cite journal | vauthors = Nishio R, Matsumori A, Shioi T, Wang W, Yamada T, Ono K, Sasayama S | title = Denopamine, a beta1-adrenergic agonist, prolongs survival in a murine model of congestive heart failure induced by viral myocarditis: suppression of tumor necrosis factor-alpha production in the heart | journal = Journal of the American College of Cardiology | volume = 32 | issue = 3 | pages = 808–15 | date = September 1998 | pmid = 9741531 | doi = 10.1016/S0735-1097(98)00314-3 | hdl = 2433/181223 | hdl-access = free }} and for clearing pulmonary edema.{{cite journal | vauthors = Sakuma T, Hida M, Nambu Y, Osanai K, Toga H, Takahashi K, Ohya N, Inoue M, Watanabe Y | display-authors = 6 | title = Beta1-adrenergic agonist is a potent stimulator of alveolar fluid clearance in hyperoxic rat lungs | journal = Japanese Journal of Pharmacology | volume = 85 | issue = 2 | pages = 161–6 | date = February 2001 | pmid = 11286398 | doi = 10.1254/jjp.85.161 | doi-access = free }} It is marketed in Japan under the brand name Kalgut and available as tablets of 5 and 10 mg, and 5% fine granules.{{cite web|title=Kalgut (denopamine) Tablets 5, 10 mg; Fine granules 5%. Full Prescribing Information|url=http://medical.mt-pharma.co.jp/di/file/dc/kal.pdf|publisher=Mitsubishi Tanabe Pharma Corporation|access-date=6 March 2016|language=Japanese}}