depramine

{{Short description|Chemical compound}}

{{Distinguish|desipramine}}

{{Drugbox

| IUPAC_name = 3-(5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine

| image = Depramine.png

| alt = Skeletal formula of depramine

| width = 190

| image2 = Depramine-3D-balls.png

| alt2 = Ball-and-stick model of the depramine molecule

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 303-54-8

| ATC_prefix = None

| ATC_suffix =

| PubChem = 67534

| ChemSpiderID = 60856

| ChEMBL = 2104158

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 77C3T28736

| C=19 | H=22 | N=2

| smiles = c3cc2c(\C=C/c1c(cccc1)N2CCCN(C)C)cc3

}}

Depramine (INN; GP-31,406), also known as balipramine (BAN) and as 10,11-dehydroimipramine, is a tricyclic antidepressant (TCA) which was never marketed.{{cite book | title = Dictionary of organic compounds | publisher = Chapman & Hall | location = London | year = 1996 | isbn = 0-412-54090-8 | url = https://books.google.com/books?id=w5dpoQRjGNEC&q=depramine&pg=PA550}}{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 }}