deptropine

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 443972172

| IUPAC_name = 3a-[(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-yl)
oxy]1aH,5aH-tropane

| image = Deptropine.svg

| width = 180

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 604-51-3

| CAS_supplemental = {{CAS|2169-75-7}}

| ATC_prefix = R06

| ATC_suffix = AX16

| PubChem = 16576

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 16735768

| DrugBank = DB13466

| ChEMBL = 1946186

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = AY31301GKG

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D07404

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 50189

| C=23 | H=27 | N=1 | O=1

| smiles = CN5[C@@H]1CC[C@H]5C[C@H](C1)OC3c4ccccc4CCc2ccccc23

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C23H27NO/c1-24-18-12-13-19(24)15-20(14-18)25-23-21-8-4-2-6-16(21)10-11-17-7-3-5-9-22(17)23/h2-9,18-20,23H,10-15H2,1H3/t18-,19+,20+

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = ZWPODSUQWXAZNC-PMOLBWCYSA-N

}}

Deptropine (Brontina) also known as dibenzheptropine, is an antihistamine with anticholinergic properties acting at the H1 receptor.{{Cite web|last=PubChem|title=Deptropine|url=https://pubchem.ncbi.nlm.nih.gov/compound/16576|access-date=2020-11-16|website=pubchem.ncbi.nlm.nih.gov|language=en}} It is usually marketed as the citrate salt.{{cite journal | vauthors = Leckie WJ, Horne NW | journal = Thorax | volume = 20 | issue = 4 | pages = 317–23 | date = July 1965 | pmid = 14321719 | pmc = 1018942 | doi = 10.1136/thx.20.4.317 | title = Preliminary Assessment of Deptropine Dihydrogen Citrate in Chronic Airways Obstruction }}